About 1-(7-oxabicyclo[4.1.0]heptan-1-yloxy)-7-oxabicyclo[4.1.0]heptane;trimethoxysilane
1-(7-oxabicyclo[4.1.0]heptan-1-yloxy)-7-oxabicyclo[4.1.0]heptane;trimethoxysilane (PubChem CID 173448734) has the molecular formula C15H28O6Si
and a molecular weight of 332.47 g/mol. Its IUPAC name is 1-(7-oxabicyclo[4.1.0]heptan-1-yloxy)-7-oxabicyclo[4.1.0]heptane;trimethoxysilane.
Molecular Properties
| Compound Name | 1-(7-oxabicyclo[4.1.0]heptan-1-yloxy)-7-oxabicyclo[4.1.0]heptane;trimethoxysilane |
| PubChem CID | 173448734 |
| Molecular Formula | C15H28O6Si |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 1-(7-oxabicyclo[4.1.0]heptan-1-yloxy)-7-oxabicyclo[4.1.0]heptane;trimethoxysilane |
| SMILES | C1CCC2(OC34CCCCC3O4)OC2C1.CO[SiH](OC)OC |
| InChI | InChI=1S/C12H18O3.C3H10O3Si/c1-3-7-11(9(5-1)13-11)15-12-8-4-2-6-10(12)14-12;1-4-7(5-2)6-3/h9-10H,1-8H2;7H,1-3H3 |
| InChIKey | UNGSVOBPVKGKKS-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 61.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-(7-oxabicyclo[4.1.0]heptan-1-yloxy)-7-oxabicyclo[4.1.0]heptane;trimethoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(7-oxabicyclo[4.1.0]heptan-1-yloxy)-7-oxabicyclo[4.1.0]heptane;trimethoxysilane?
The IUPAC name of 1-(7-oxabicyclo[4.1.0]heptan-1-yloxy)-7-oxabicyclo[4.1.0]heptane;trimethoxysilane (CID 173448734) is 1-(7-oxabicyclo[4.1.0]heptan-1-yloxy)-7-oxabicyclo[4.1.0]heptane;trimethoxysilane.
What is the SMILES notation for 1-(7-oxabicyclo[4.1.0]heptan-1-yloxy)-7-oxabicyclo[4.1.0]heptane;trimethoxysilane?
The canonical SMILES for 1-(7-oxabicyclo[4.1.0]heptan-1-yloxy)-7-oxabicyclo[4.1.0]heptane;trimethoxysilane is C1CCC2(OC34CCCCC3O4)OC2C1.CO[SiH](OC)OC.
What is the InChIKey of 1-(7-oxabicyclo[4.1.0]heptan-1-yloxy)-7-oxabicyclo[4.1.0]heptane;trimethoxysilane?
The InChIKey is UNGSVOBPVKGKKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O3.C3H10O3Si/c1-3-7-11(9(5-1)13-11)15-12-8-4-2-6-10(12)14-12;1-4-7(5-2)6-3/h9-10H,1-8H2;7H,1-3H3.
What are the key properties of 1-(7-oxabicyclo[4.1.0]heptan-1-yloxy)-7-oxabicyclo[4.1.0]heptane;trimethoxysilane?
1-(7-oxabicyclo[4.1.0]heptan-1-yloxy)-7-oxabicyclo[4.1.0]heptane;trimethoxysilane has a molecular weight of 332.47 g/mol, XLogP of 1.98, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(7-oxabicyclo[4.1.0]heptan-1-yloxy)-7-oxabicyclo[4.1.0]heptane;trimethoxysilane is sourced from PubChem (CID 173448734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).