About tert-butyl 2-[(4-amino-5-hydrazinyl-1,2,4-triazol-3-yl)sulfanyl]acetate
tert-butyl 2-[(4-amino-5-hydrazinyl-1,2,4-triazol-3-yl)sulfanyl]acetate (PubChem CID 17344941) has the molecular formula C8H16N6O2S
and a molecular weight of 260.32 g/mol. Its IUPAC name is tert-butyl 2-[(4-amino-5-hydrazinyl-1,2,4-triazol-3-yl)sulfanyl]acetate.
Molecular Properties
| Compound Name | tert-butyl 2-[(4-amino-5-hydrazinyl-1,2,4-triazol-3-yl)sulfanyl]acetate |
| PubChem CID | 17344941 |
| Molecular Formula | C8H16N6O2S |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | tert-butyl 2-[(4-amino-5-hydrazinyl-1,2,4-triazol-3-yl)sulfanyl]acetate |
| SMILES | CC(C)(C)OC(=O)CSc1nnc(NN)n1N |
| InChI | InChI=1S/C8H16N6O2S/c1-8(2,3)16-5(15)4-17-7-13-12-6(11-9)14(7)10/h4,9-10H2,1-3H3,(H,11,12) |
| InChIKey | FBWVTFJRCQOTIT-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 121.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-[(4-amino-5-hydrazinyl-1,2,4-triazol-3-yl)sulfanyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[(4-amino-5-hydrazinyl-1,2,4-triazol-3-yl)sulfanyl]acetate?
The IUPAC name of tert-butyl 2-[(4-amino-5-hydrazinyl-1,2,4-triazol-3-yl)sulfanyl]acetate (CID 17344941) is tert-butyl 2-[(4-amino-5-hydrazinyl-1,2,4-triazol-3-yl)sulfanyl]acetate.
What is the SMILES notation for tert-butyl 2-[(4-amino-5-hydrazinyl-1,2,4-triazol-3-yl)sulfanyl]acetate?
The canonical SMILES for tert-butyl 2-[(4-amino-5-hydrazinyl-1,2,4-triazol-3-yl)sulfanyl]acetate is CC(C)(C)OC(=O)CSc1nnc(NN)n1N.
What is the InChIKey of tert-butyl 2-[(4-amino-5-hydrazinyl-1,2,4-triazol-3-yl)sulfanyl]acetate?
The InChIKey is FBWVTFJRCQOTIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N6O2S/c1-8(2,3)16-5(15)4-17-7-13-12-6(11-9)14(7)10/h4,9-10H2,1-3H3,(H,11,12).
What are the key properties of tert-butyl 2-[(4-amino-5-hydrazinyl-1,2,4-triazol-3-yl)sulfanyl]acetate?
tert-butyl 2-[(4-amino-5-hydrazinyl-1,2,4-triazol-3-yl)sulfanyl]acetate has a molecular weight of 260.32 g/mol, XLogP of -0.29, 4 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[(4-amino-5-hydrazinyl-1,2,4-triazol-3-yl)sulfanyl]acetate is sourced from PubChem (CID 17344941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).