C26H14N6 — CID 173449611
4-(2-cyanoethenyl)-5-[2,3,4-tris(2-cyanoethenyl)phenyl]octa-2,4,6-trienedinitrile (PubChem CID 173449611) has the molecular formula C26H14N6 and a molecular weight of 410.44 g/mol. Its IUPAC name is 4-(2-cyanoethenyl)-5-[2,3,4-tris(2-cyanoethenyl)phenyl]octa-2,4,6-trienedinitrile.
| Compound Name | 4-(2-cyanoethenyl)-5-[2,3,4-tris(2-cyanoethenyl)phenyl]octa-2,4,6-trienedinitrile |
|---|---|
| PubChem CID | 173449611 |
| Molecular Formula | C26H14N6 |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 4-(2-cyanoethenyl)-5-[2,3,4-tris(2-cyanoethenyl)phenyl]octa-2,4,6-trienedinitrile |
| SMILES | N#CC=CC(C=CC#N)=C(C=CC#N)c1ccc(C=CC#N)c(C=CC#N)c1C=CC#N |
| InChI | InChI=1S/C26H14N6/c27-15-1-7-21(8-2-16-28)23(10-4-18-30)26-14-13-22(9-3-17-29)24(11-5-19-31)25(26)12-6-20-32/h1-14H |
| InChIKey | ZFBIWDOZFLQZJF-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 142.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|