About azane;4-phenyl-1-(3,3,3-triphenylpropyl)piperidine-4-carboxylic acid
azane;4-phenyl-1-(3,3,3-triphenylpropyl)piperidine-4-carboxylic acid (PubChem CID 173450342) has the molecular formula C33H36N2O2
and a molecular weight of 492.66 g/mol. Its IUPAC name is azane;4-phenyl-1-(3,3,3-triphenylpropyl)piperidine-4-carboxylic acid.
Molecular Properties
| Compound Name | azane;4-phenyl-1-(3,3,3-triphenylpropyl)piperidine-4-carboxylic acid |
| PubChem CID | 173450342 |
| Molecular Formula | C33H36N2O2 |
| Molecular Weight | 492.66 g/mol |
| Exact Mass | 492.28 |
| IUPAC Name | azane;4-phenyl-1-(3,3,3-triphenylpropyl)piperidine-4-carboxylic acid |
| SMILES | N.O=C(O)C1(c2ccccc2)CCN(CCC(c2ccccc2)(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C33H33NO2.H3N/c35-31(36)32(27-13-5-1-6-14-27)21-24-34(25-22-32)26-23-33(28-15-7-2-8-16-28,29-17-9-3-10-18-29)30-19-11-4-12-20-30;/h1-20H,21-26H2,(H,35,36);1H3 |
| InChIKey | GFZGUCWDOHBXQN-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 75.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 492.66 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze azane;4-phenyl-1-(3,3,3-triphenylpropyl)piperidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;4-phenyl-1-(3,3,3-triphenylpropyl)piperidine-4-carboxylic acid?
The IUPAC name of azane;4-phenyl-1-(3,3,3-triphenylpropyl)piperidine-4-carboxylic acid (CID 173450342) is azane;4-phenyl-1-(3,3,3-triphenylpropyl)piperidine-4-carboxylic acid.
What is the SMILES notation for azane;4-phenyl-1-(3,3,3-triphenylpropyl)piperidine-4-carboxylic acid?
The canonical SMILES for azane;4-phenyl-1-(3,3,3-triphenylpropyl)piperidine-4-carboxylic acid is N.O=C(O)C1(c2ccccc2)CCN(CCC(c2ccccc2)(c2ccccc2)c2ccccc2)CC1.
What is the InChIKey of azane;4-phenyl-1-(3,3,3-triphenylpropyl)piperidine-4-carboxylic acid?
The InChIKey is GFZGUCWDOHBXQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H33NO2.H3N/c35-31(36)32(27-13-5-1-6-14-27)21-24-34(25-22-32)26-23-33(28-15-7-2-8-16-28,29-17-9-3-10-18-29)30-19-11-4-12-20-30;/h1-20H,21-26H2,(H,35,36);1H3.
What are the key properties of azane;4-phenyl-1-(3,3,3-triphenylpropyl)piperidine-4-carboxylic acid?
azane;4-phenyl-1-(3,3,3-triphenylpropyl)piperidine-4-carboxylic acid has a molecular weight of 492.66 g/mol, XLogP of 6.69, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;4-phenyl-1-(3,3,3-triphenylpropyl)piperidine-4-carboxylic acid is sourced from PubChem (CID 173450342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).