C18H12Cl4 — CID 173450499
2,5-dichloro-1,5-bis(2-chlorophenyl)cyclohexa-1,3-diene (PubChem CID 173450499) has the molecular formula C18H12Cl4 and a molecular weight of 370.11 g/mol. Its IUPAC name is 2,5-dichloro-1,5-bis(2-chlorophenyl)cyclohexa-1,3-diene.
| Compound Name | 2,5-dichloro-1,5-bis(2-chlorophenyl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 173450499 |
| Molecular Formula | C18H12Cl4 |
| Molecular Weight | 370.11 g/mol |
| Exact Mass | 367.97 |
| IUPAC Name | 2,5-dichloro-1,5-bis(2-chlorophenyl)cyclohexa-1,3-diene |
| SMILES | ClC1=C(c2ccccc2Cl)CC(Cl)(c2ccccc2Cl)C=C1 |
| InChI | InChI=1S/C18H12Cl4/c19-15-7-3-1-5-12(15)13-11-18(22,10-9-16(13)20)14-6-2-4-8-17(14)21/h1-10H,11H2 |
| InChIKey | NVXUWEFRSIJNME-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.11 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|