About 3-(5-chloro-1,3-thiazol-2-yl)-1-hex-4-enyl-3-oxidoimidazolidin-3-ium-4-ol
3-(5-chloro-1,3-thiazol-2-yl)-1-hex-4-enyl-3-oxidoimidazolidin-3-ium-4-ol (PubChem CID 173450754) has the molecular formula C12H18ClN3O2S
and a molecular weight of 303.81 g/mol. Its IUPAC name is 3-(5-chloro-1,3-thiazol-2-yl)-1-hex-4-enyl-3-oxidoimidazolidin-3-ium-4-ol.
Molecular Properties
| Compound Name | 3-(5-chloro-1,3-thiazol-2-yl)-1-hex-4-enyl-3-oxidoimidazolidin-3-ium-4-ol |
| PubChem CID | 173450754 |
| Molecular Formula | C12H18ClN3O2S |
| Molecular Weight | 303.81 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 3-(5-chloro-1,3-thiazol-2-yl)-1-hex-4-enyl-3-oxidoimidazolidin-3-ium-4-ol |
| SMILES | CC=CCCCN1CC(O)[N+]([O-])(c2ncc(Cl)s2)C1 |
| InChI | InChI=1S/C12H18ClN3O2S/c1-2-3-4-5-6-15-8-11(17)16(18,9-15)12-14-7-10(13)19-12/h2-3,7,11,17H,4-6,8-9H2,1H3 |
| InChIKey | LBCPKPCBPZDTJI-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.81 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(5-chloro-1,3-thiazol-2-yl)-1-hex-4-enyl-3-oxidoimidazolidin-3-ium-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-chloro-1,3-thiazol-2-yl)-1-hex-4-enyl-3-oxidoimidazolidin-3-ium-4-ol?
The IUPAC name of 3-(5-chloro-1,3-thiazol-2-yl)-1-hex-4-enyl-3-oxidoimidazolidin-3-ium-4-ol (CID 173450754) is 3-(5-chloro-1,3-thiazol-2-yl)-1-hex-4-enyl-3-oxidoimidazolidin-3-ium-4-ol.
What is the SMILES notation for 3-(5-chloro-1,3-thiazol-2-yl)-1-hex-4-enyl-3-oxidoimidazolidin-3-ium-4-ol?
The canonical SMILES for 3-(5-chloro-1,3-thiazol-2-yl)-1-hex-4-enyl-3-oxidoimidazolidin-3-ium-4-ol is CC=CCCCN1CC(O)[N+]([O-])(c2ncc(Cl)s2)C1.
What is the InChIKey of 3-(5-chloro-1,3-thiazol-2-yl)-1-hex-4-enyl-3-oxidoimidazolidin-3-ium-4-ol?
The InChIKey is LBCPKPCBPZDTJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18ClN3O2S/c1-2-3-4-5-6-15-8-11(17)16(18,9-15)12-14-7-10(13)19-12/h2-3,7,11,17H,4-6,8-9H2,1H3.
What are the key properties of 3-(5-chloro-1,3-thiazol-2-yl)-1-hex-4-enyl-3-oxidoimidazolidin-3-ium-4-ol?
3-(5-chloro-1,3-thiazol-2-yl)-1-hex-4-enyl-3-oxidoimidazolidin-3-ium-4-ol has a molecular weight of 303.81 g/mol, XLogP of 2.55, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-chloro-1,3-thiazol-2-yl)-1-hex-4-enyl-3-oxidoimidazolidin-3-ium-4-ol is sourced from PubChem (CID 173450754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).