About [(3R)-2-(4,8-dimethyl-5-oxonon-7-enyl)-2-methyl-6-(2-oxoethylidene)oxepan-3-yl] acetate
[(3R)-2-(4,8-dimethyl-5-oxonon-7-enyl)-2-methyl-6-(2-oxoethylidene)oxepan-3-yl] acetate (PubChem CID 173450820) has the molecular formula C22H34O5
and a molecular weight of 378.51 g/mol. Its IUPAC name is [(3R)-2-(4,8-dimethyl-5-oxonon-7-enyl)-2-methyl-6-(2-oxoethylidene)oxepan-3-yl] acetate.
Molecular Properties
| Compound Name | [(3R)-2-(4,8-dimethyl-5-oxonon-7-enyl)-2-methyl-6-(2-oxoethylidene)oxepan-3-yl] acetate |
| PubChem CID | 173450820 |
| Molecular Formula | C22H34O5 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | [(3R)-2-(4,8-dimethyl-5-oxonon-7-enyl)-2-methyl-6-(2-oxoethylidene)oxepan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CCC(=CC=O)COC1(C)CCCC(C)C(=O)CC=C(C)C |
| InChI | InChI=1S/C22H34O5/c1-16(2)8-10-20(25)17(3)7-6-13-22(5)21(27-18(4)24)11-9-19(12-14-23)15-26-22/h8,12,14,17,21H,6-7,9-11,13,15H2,1-5H3/t17?,21-,22?/m1/s1 |
| InChIKey | HVKGLFXDAZKVNN-PDRFFQIWSA-N |
| XLogP | 4.34 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [(3R)-2-(4,8-dimethyl-5-oxonon-7-enyl)-2-methyl-6-(2-oxoethylidene)oxepan-3-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-2-(4,8-dimethyl-5-oxonon-7-enyl)-2-methyl-6-(2-oxoethylidene)oxepan-3-yl] acetate?
The IUPAC name of [(3R)-2-(4,8-dimethyl-5-oxonon-7-enyl)-2-methyl-6-(2-oxoethylidene)oxepan-3-yl] acetate (CID 173450820) is [(3R)-2-(4,8-dimethyl-5-oxonon-7-enyl)-2-methyl-6-(2-oxoethylidene)oxepan-3-yl] acetate.
What is the SMILES notation for [(3R)-2-(4,8-dimethyl-5-oxonon-7-enyl)-2-methyl-6-(2-oxoethylidene)oxepan-3-yl] acetate?
The canonical SMILES for [(3R)-2-(4,8-dimethyl-5-oxonon-7-enyl)-2-methyl-6-(2-oxoethylidene)oxepan-3-yl] acetate is CC(=O)O[C@@H]1CCC(=CC=O)COC1(C)CCCC(C)C(=O)CC=C(C)C.
What is the InChIKey of [(3R)-2-(4,8-dimethyl-5-oxonon-7-enyl)-2-methyl-6-(2-oxoethylidene)oxepan-3-yl] acetate?
The InChIKey is HVKGLFXDAZKVNN-PDRFFQIWSA-N. The full InChI is InChI=1S/C22H34O5/c1-16(2)8-10-20(25)17(3)7-6-13-22(5)21(27-18(4)24)11-9-19(12-14-23)15-26-22/h8,12,14,17,21H,6-7,9-11,13,15H2,1-5H3/t17?,21-,22?/m1/s1.
What are the key properties of [(3R)-2-(4,8-dimethyl-5-oxonon-7-enyl)-2-methyl-6-(2-oxoethylidene)oxepan-3-yl] acetate?
[(3R)-2-(4,8-dimethyl-5-oxonon-7-enyl)-2-methyl-6-(2-oxoethylidene)oxepan-3-yl] acetate has a molecular weight of 378.51 g/mol, XLogP of 4.34, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-2-(4,8-dimethyl-5-oxonon-7-enyl)-2-methyl-6-(2-oxoethylidene)oxepan-3-yl] acetate is sourced from PubChem (CID 173450820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).