C21H21I2N3O3 — CID 173451372
bicyclo[3.1.0]hexa-1(6),2,4-triene;1-[[2-(hydroxyiminomethyl)pyridin-1-ium-1-yl]methoxy]-1-pyridin-1-ium-1-ylpropan-2-one;diiodide (PubChem CID 173451372) has the molecular formula C21H21I2N3O3 and a molecular weight of 617.23 g/mol. Its IUPAC name is bicyclo[3.1.0]hexa-1(6),2,4-triene;1-[[2-(hydroxyiminomethyl)pyridin-1-ium-1-yl]methoxy]-1-pyridin-1-ium-1-ylpropan-2-one;diiodide.
| Compound Name | bicyclo[3.1.0]hexa-1(6),2,4-triene;1-[[2-(hydroxyiminomethyl)pyridin-1-ium-1-yl]methoxy]-1-pyridin-1-ium-1-ylpropan-2-one;diiodide |
|---|---|
| PubChem CID | 173451372 |
| Molecular Formula | C21H21I2N3O3 |
| Molecular Weight | 617.23 g/mol |
| Exact Mass | 616.97 |
| IUPAC Name | bicyclo[3.1.0]hexa-1(6),2,4-triene;1-[[2-(hydroxyiminomethyl)pyridin-1-ium-1-yl]methoxy]-1-pyridin-1-ium-1-ylpropan-2-one;diiodide |
| SMILES | CC(=O)C(OC[n+]1ccccc1C=NO)[n+]1ccccc1.[I-].[I-].c1cc2cc-2c1 |
| InChI | InChI=1S/C15H16N3O3.C6H4.2HI/c1-13(19)15(17-8-4-2-5-9-17)21-12-18-10-6-3-7-14(18)11-16-20;1-2-5-4-6(5)3-1;;/h2-11,15H,12H2,1H3;1-4H;2*1H/q+1;;;/p-1 |
| InChIKey | BZMUOFVHIAPPFB-UHFFFAOYSA-M |
| XLogP | -3.49 |
| TPSA | 66.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.23 |
| LogP ≤ 5 | -3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|