C8H19N3 — CID 173451516
1-N',1-N',4-N,4-N-tetramethylbut-2-ene-1,1,4-triamine (PubChem CID 173451516) has the molecular formula C8H19N3 and a molecular weight of 157.26 g/mol. Its IUPAC name is 1-N',1-N',4-N,4-N-tetramethylbut-2-ene-1,1,4-triamine.
| Compound Name | 1-N',1-N',4-N,4-N-tetramethylbut-2-ene-1,1,4-triamine |
|---|---|
| PubChem CID | 173451516 |
| Molecular Formula | C8H19N3 |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.16 |
| IUPAC Name | 1-N',1-N',4-N,4-N-tetramethylbut-2-ene-1,1,4-triamine |
| SMILES | CN(C)CC=CC(N)N(C)C |
| InChI | InChI=1S/C8H19N3/c1-10(2)7-5-6-8(9)11(3)4/h5-6,8H,7,9H2,1-4H3 |
| InChIKey | NUZFTZXAIFHDAR-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|