About bis(2-methylcyclohexa-2,5-dien-1-yl)diazene
bis(2-methylcyclohexa-2,5-dien-1-yl)diazene (PubChem CID 173451525) has the molecular formula C14H18N2
and a molecular weight of 214.31 g/mol. Its IUPAC name is bis(2-methylcyclohexa-2,5-dien-1-yl)diazene.
Molecular Properties
| Compound Name | bis(2-methylcyclohexa-2,5-dien-1-yl)diazene |
| PubChem CID | 173451525 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | bis(2-methylcyclohexa-2,5-dien-1-yl)diazene |
| SMILES | CC1=CCC=CC1/N=N/C1C=CCC=C1C |
| InChI | InChI=1S/C14H18N2/c1-11-7-3-5-9-13(11)15-16-14-10-6-4-8-12(14)2/h5-10,13-14H,3-4H2,1-2H3/b16-15+ |
| InChIKey | RQEZHKKOYXYSNE-FOCLMDBBSA-N |
| XLogP | 3.99 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze bis(2-methylcyclohexa-2,5-dien-1-yl)diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-methylcyclohexa-2,5-dien-1-yl)diazene?
The IUPAC name of bis(2-methylcyclohexa-2,5-dien-1-yl)diazene (CID 173451525) is bis(2-methylcyclohexa-2,5-dien-1-yl)diazene.
What is the SMILES notation for bis(2-methylcyclohexa-2,5-dien-1-yl)diazene?
The canonical SMILES for bis(2-methylcyclohexa-2,5-dien-1-yl)diazene is CC1=CCC=CC1/N=N/C1C=CCC=C1C.
What is the InChIKey of bis(2-methylcyclohexa-2,5-dien-1-yl)diazene?
The InChIKey is RQEZHKKOYXYSNE-FOCLMDBBSA-N. The full InChI is InChI=1S/C14H18N2/c1-11-7-3-5-9-13(11)15-16-14-10-6-4-8-12(14)2/h5-10,13-14H,3-4H2,1-2H3/b16-15+.
What are the key properties of bis(2-methylcyclohexa-2,5-dien-1-yl)diazene?
bis(2-methylcyclohexa-2,5-dien-1-yl)diazene has a molecular weight of 214.31 g/mol, XLogP of 3.99, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-methylcyclohexa-2,5-dien-1-yl)diazene is sourced from PubChem (CID 173451525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).