About 10-amino-4,8-dimethyldeca-4,8-dien-1-ol
10-amino-4,8-dimethyldeca-4,8-dien-1-ol (PubChem CID 173451830) has the molecular formula C12H23NO
and a molecular weight of 197.32 g/mol. Its IUPAC name is 10-amino-4,8-dimethyldeca-4,8-dien-1-ol.
Molecular Properties
| Compound Name | 10-amino-4,8-dimethyldeca-4,8-dien-1-ol |
| PubChem CID | 173451830 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 10-amino-4,8-dimethyldeca-4,8-dien-1-ol |
| SMILES | CC(=CCN)CCC=C(C)CCCO |
| InChI | InChI=1S/C12H23NO/c1-11(7-4-10-14)5-3-6-12(2)8-9-13/h5,8,14H,3-4,6-7,9-10,13H2,1-2H3 |
| InChIKey | LWRPQTGSSKCUNZ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 10-amino-4,8-dimethyldeca-4,8-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-amino-4,8-dimethyldeca-4,8-dien-1-ol?
The IUPAC name of 10-amino-4,8-dimethyldeca-4,8-dien-1-ol (CID 173451830) is 10-amino-4,8-dimethyldeca-4,8-dien-1-ol.
What is the SMILES notation for 10-amino-4,8-dimethyldeca-4,8-dien-1-ol?
The canonical SMILES for 10-amino-4,8-dimethyldeca-4,8-dien-1-ol is CC(=CCN)CCC=C(C)CCCO.
What is the InChIKey of 10-amino-4,8-dimethyldeca-4,8-dien-1-ol?
The InChIKey is LWRPQTGSSKCUNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO/c1-11(7-4-10-14)5-3-6-12(2)8-9-13/h5,8,14H,3-4,6-7,9-10,13H2,1-2H3.
What are the key properties of 10-amino-4,8-dimethyldeca-4,8-dien-1-ol?
10-amino-4,8-dimethyldeca-4,8-dien-1-ol has a molecular weight of 197.32 g/mol, XLogP of 2.39, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10-amino-4,8-dimethyldeca-4,8-dien-1-ol is sourced from PubChem (CID 173451830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).