C9H2Cl6O2 — CID 173451875
(Z)-2-chloro-3-(2,3,4,5,6-pentachlorophenyl)prop-2-enoic acid (PubChem CID 173451875) has the molecular formula C9H2Cl6O2 and a molecular weight of 354.83 g/mol. Its IUPAC name is (Z)-2-chloro-3-(2,3,4,5,6-pentachlorophenyl)prop-2-enoic acid.
| Compound Name | (Z)-2-chloro-3-(2,3,4,5,6-pentachlorophenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 173451875 |
| Molecular Formula | C9H2Cl6O2 |
| Molecular Weight | 354.83 g/mol |
| Exact Mass | 351.82 |
| IUPAC Name | (Z)-2-chloro-3-(2,3,4,5,6-pentachlorophenyl)prop-2-enoic acid |
| SMILES | O=C(O)/C(Cl)=C/c1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C9H2Cl6O2/c10-3(9(16)17)1-2-4(11)6(13)8(15)7(14)5(2)12/h1H,(H,16,17)/b3-1- |
| InChIKey | DCAMUURUAGICEL-IWQZZHSRSA-N |
| XLogP | 5.62 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.83 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|