About 2-methoxysilyloxan-2-ol
2-methoxysilyloxan-2-ol (PubChem CID 173452142) has the molecular formula C6H14O3Si
and a molecular weight of 162.26 g/mol. Its IUPAC name is 2-methoxysilyloxan-2-ol.
Molecular Properties
| Compound Name | 2-methoxysilyloxan-2-ol |
| PubChem CID | 173452142 |
| Molecular Formula | C6H14O3Si |
| Molecular Weight | 162.26 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | 2-methoxysilyloxan-2-ol |
| SMILES | CO[SiH2]C1(O)CCCCO1 |
| InChI | InChI=1S/C6H14O3Si/c1-8-10-6(7)4-2-3-5-9-6/h7H,2-5,10H2,1H3 |
| InChIKey | PMSCNGGHJJPTLG-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.26 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxysilyloxan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxysilyloxan-2-ol?
The IUPAC name of 2-methoxysilyloxan-2-ol (CID 173452142) is 2-methoxysilyloxan-2-ol.
What is the SMILES notation for 2-methoxysilyloxan-2-ol?
The canonical SMILES for 2-methoxysilyloxan-2-ol is CO[SiH2]C1(O)CCCCO1.
What is the InChIKey of 2-methoxysilyloxan-2-ol?
The InChIKey is PMSCNGGHJJPTLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O3Si/c1-8-10-6(7)4-2-3-5-9-6/h7H,2-5,10H2,1H3.
What are the key properties of 2-methoxysilyloxan-2-ol?
2-methoxysilyloxan-2-ol has a molecular weight of 162.26 g/mol, XLogP of -0.44, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxysilyloxan-2-ol is sourced from PubChem (CID 173452142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).