About 2-(5,6-dihydrobenzo[b][1]benzothiepin-3-yl)acetic acid;propan-2-amine
2-(5,6-dihydrobenzo[b][1]benzothiepin-3-yl)acetic acid;propan-2-amine (PubChem CID 173452264) has the molecular formula C19H23NO2S
and a molecular weight of 329.47 g/mol. Its IUPAC name is 2-(5,6-dihydrobenzo[b][1]benzothiepin-3-yl)acetic acid;propan-2-amine.
Molecular Properties
| Compound Name | 2-(5,6-dihydrobenzo[b][1]benzothiepin-3-yl)acetic acid;propan-2-amine |
| PubChem CID | 173452264 |
| Molecular Formula | C19H23NO2S |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 2-(5,6-dihydrobenzo[b][1]benzothiepin-3-yl)acetic acid;propan-2-amine |
| SMILES | CC(C)N.O=C(O)Cc1ccc2c(c1)CCc1ccccc1S2 |
| InChI | InChI=1S/C16H14O2S.C3H9N/c17-16(18)10-11-5-8-15-13(9-11)7-6-12-3-1-2-4-14(12)19-15;1-3(2)4/h1-5,8-9H,6-7,10H2,(H,17,18);3H,4H2,1-2H3 |
| InChIKey | RIFHSEMPJIJDIE-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(5,6-dihydrobenzo[b][1]benzothiepin-3-yl)acetic acid;propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5,6-dihydrobenzo[b][1]benzothiepin-3-yl)acetic acid;propan-2-amine?
The IUPAC name of 2-(5,6-dihydrobenzo[b][1]benzothiepin-3-yl)acetic acid;propan-2-amine (CID 173452264) is 2-(5,6-dihydrobenzo[b][1]benzothiepin-3-yl)acetic acid;propan-2-amine.
What is the SMILES notation for 2-(5,6-dihydrobenzo[b][1]benzothiepin-3-yl)acetic acid;propan-2-amine?
The canonical SMILES for 2-(5,6-dihydrobenzo[b][1]benzothiepin-3-yl)acetic acid;propan-2-amine is CC(C)N.O=C(O)Cc1ccc2c(c1)CCc1ccccc1S2.
What is the InChIKey of 2-(5,6-dihydrobenzo[b][1]benzothiepin-3-yl)acetic acid;propan-2-amine?
The InChIKey is RIFHSEMPJIJDIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O2S.C3H9N/c17-16(18)10-11-5-8-15-13(9-11)7-6-12-3-1-2-4-14(12)19-15;1-3(2)4/h1-5,8-9H,6-7,10H2,(H,17,18);3H,4H2,1-2H3.
What are the key properties of 2-(5,6-dihydrobenzo[b][1]benzothiepin-3-yl)acetic acid;propan-2-amine?
2-(5,6-dihydrobenzo[b][1]benzothiepin-3-yl)acetic acid;propan-2-amine has a molecular weight of 329.47 g/mol, XLogP of 3.92, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5,6-dihydrobenzo[b][1]benzothiepin-3-yl)acetic acid;propan-2-amine is sourced from PubChem (CID 173452264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).