About 5-bromo-2,3,4-trimethylpent-2-enoic acid
5-bromo-2,3,4-trimethylpent-2-enoic acid (PubChem CID 173452571) has the molecular formula C8H13BrO2
and a molecular weight of 221.09 g/mol. Its IUPAC name is 5-bromo-2,3,4-trimethylpent-2-enoic acid.
Molecular Properties
| Compound Name | 5-bromo-2,3,4-trimethylpent-2-enoic acid |
| PubChem CID | 173452571 |
| Molecular Formula | C8H13BrO2 |
| Molecular Weight | 221.09 g/mol |
| Exact Mass | 220.01 |
| IUPAC Name | 5-bromo-2,3,4-trimethylpent-2-enoic acid |
| SMILES | CC(C(=O)O)=C(C)C(C)CBr |
| InChI | InChI=1S/C8H13BrO2/c1-5(4-9)6(2)7(3)8(10)11/h5H,4H2,1-3H3,(H,10,11) |
| InChIKey | UVURWRKHYJCAHP-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.09 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-2,3,4-trimethylpent-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2,3,4-trimethylpent-2-enoic acid?
The IUPAC name of 5-bromo-2,3,4-trimethylpent-2-enoic acid (CID 173452571) is 5-bromo-2,3,4-trimethylpent-2-enoic acid.
What is the SMILES notation for 5-bromo-2,3,4-trimethylpent-2-enoic acid?
The canonical SMILES for 5-bromo-2,3,4-trimethylpent-2-enoic acid is CC(C(=O)O)=C(C)C(C)CBr.
What is the InChIKey of 5-bromo-2,3,4-trimethylpent-2-enoic acid?
The InChIKey is UVURWRKHYJCAHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13BrO2/c1-5(4-9)6(2)7(3)8(10)11/h5H,4H2,1-3H3,(H,10,11).
What are the key properties of 5-bromo-2,3,4-trimethylpent-2-enoic acid?
5-bromo-2,3,4-trimethylpent-2-enoic acid has a molecular weight of 221.09 g/mol, XLogP of 2.44, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2,3,4-trimethylpent-2-enoic acid is sourced from PubChem (CID 173452571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).