5-bromo-2,3,4-trimethylpent-2-enoic acid

C8H13BrO2 — CID 173452571

IUPAC5-bromo-2,3,4-trimethylpent-2-enoic acid
SMILESCC(C(=O)O)=C(C)C(C)CBr
InChIInChI=1S/C8H13BrO2/c1-5(4-9)6(2)7(3)8(10)11/h5H,4H2,1-3H3,(H,10,11)
InChIKeyUVURWRKHYJCAHP-UHFFFAOYSA-N
MW221.09 g/mol
LogP2.44
Rot. Bonds3

About 5-bromo-2,3,4-trimethylpent-2-enoic acid

5-bromo-2,3,4-trimethylpent-2-enoic acid (PubChem CID 173452571) has the molecular formula C8H13BrO2 and a molecular weight of 221.09 g/mol. Its IUPAC name is 5-bromo-2,3,4-trimethylpent-2-enoic acid.

Molecular Properties

Compound Name5-bromo-2,3,4-trimethylpent-2-enoic acid
PubChem CID173452571
Molecular FormulaC8H13BrO2
Molecular Weight221.09 g/mol
Exact Mass220.01
IUPAC Name5-bromo-2,3,4-trimethylpent-2-enoic acid
SMILESCC(C(=O)O)=C(C)C(C)CBr
InChIInChI=1S/C8H13BrO2/c1-5(4-9)6(2)7(3)8(10)11/h5H,4H2,1-3H3,(H,10,11)
InChIKeyUVURWRKHYJCAHP-UHFFFAOYSA-N
XLogP2.44
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500221.09
LogP ≤ 52.44
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 5-bromo-2,3,4-trimethylpent-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-bromo-2,3,4-trimethylpent-2-enoic acid?
The IUPAC name of 5-bromo-2,3,4-trimethylpent-2-enoic acid (CID 173452571) is 5-bromo-2,3,4-trimethylpent-2-enoic acid.
What is the SMILES notation for 5-bromo-2,3,4-trimethylpent-2-enoic acid?
The canonical SMILES for 5-bromo-2,3,4-trimethylpent-2-enoic acid is CC(C(=O)O)=C(C)C(C)CBr.
What is the InChIKey of 5-bromo-2,3,4-trimethylpent-2-enoic acid?
The InChIKey is UVURWRKHYJCAHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13BrO2/c1-5(4-9)6(2)7(3)8(10)11/h5H,4H2,1-3H3,(H,10,11).
What are the key properties of 5-bromo-2,3,4-trimethylpent-2-enoic acid?
5-bromo-2,3,4-trimethylpent-2-enoic acid has a molecular weight of 221.09 g/mol, XLogP of 2.44, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2,3,4-trimethylpent-2-enoic acid is sourced from PubChem (CID 173452571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).