About ethyl N-butan-2-yl-N-[(3,5-dichlorophenyl)sulfanylcarbamoyl]-N'-(dimethylcarbamoyl)carbamimidate
ethyl N-butan-2-yl-N-[(3,5-dichlorophenyl)sulfanylcarbamoyl]-N'-(dimethylcarbamoyl)carbamimidate (PubChem CID 173453197) has the molecular formula C17H24Cl2N4O3S
and a molecular weight of 435.38 g/mol. Its IUPAC name is ethyl N-butan-2-yl-N-[(3,5-dichlorophenyl)sulfanylcarbamoyl]-N'-(dimethylcarbamoyl)carbamimidate.
Molecular Properties
| Compound Name | ethyl N-butan-2-yl-N-[(3,5-dichlorophenyl)sulfanylcarbamoyl]-N'-(dimethylcarbamoyl)carbamimidate |
| PubChem CID | 173453197 |
| Molecular Formula | C17H24Cl2N4O3S |
| Molecular Weight | 435.38 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | ethyl N-butan-2-yl-N-[(3,5-dichlorophenyl)sulfanylcarbamoyl]-N'-(dimethylcarbamoyl)carbamimidate |
| SMILES | CCOC(=NC(=O)N(C)C)N(C(=O)NSc1cc(Cl)cc(Cl)c1)C(C)CC |
| InChI | InChI=1S/C17H24Cl2N4O3S/c1-6-11(3)23(17(26-7-2)20-15(24)22(4)5)16(25)21-27-14-9-12(18)8-13(19)10-14/h8-11H,6-7H2,1-5H3,(H,21,25) |
| InChIKey | PRBHYHQGRBTNJS-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 435.38 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-butan-2-yl-N-[(3,5-dichlorophenyl)sulfanylcarbamoyl]-N'-(dimethylcarbamoyl)carbamimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-butan-2-yl-N-[(3,5-dichlorophenyl)sulfanylcarbamoyl]-N'-(dimethylcarbamoyl)carbamimidate?
The IUPAC name of ethyl N-butan-2-yl-N-[(3,5-dichlorophenyl)sulfanylcarbamoyl]-N'-(dimethylcarbamoyl)carbamimidate (CID 173453197) is ethyl N-butan-2-yl-N-[(3,5-dichlorophenyl)sulfanylcarbamoyl]-N'-(dimethylcarbamoyl)carbamimidate.
What is the SMILES notation for ethyl N-butan-2-yl-N-[(3,5-dichlorophenyl)sulfanylcarbamoyl]-N'-(dimethylcarbamoyl)carbamimidate?
The canonical SMILES for ethyl N-butan-2-yl-N-[(3,5-dichlorophenyl)sulfanylcarbamoyl]-N'-(dimethylcarbamoyl)carbamimidate is CCOC(=NC(=O)N(C)C)N(C(=O)NSc1cc(Cl)cc(Cl)c1)C(C)CC.
What is the InChIKey of ethyl N-butan-2-yl-N-[(3,5-dichlorophenyl)sulfanylcarbamoyl]-N'-(dimethylcarbamoyl)carbamimidate?
The InChIKey is PRBHYHQGRBTNJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24Cl2N4O3S/c1-6-11(3)23(17(26-7-2)20-15(24)22(4)5)16(25)21-27-14-9-12(18)8-13(19)10-14/h8-11H,6-7H2,1-5H3,(H,21,25).
What are the key properties of ethyl N-butan-2-yl-N-[(3,5-dichlorophenyl)sulfanylcarbamoyl]-N'-(dimethylcarbamoyl)carbamimidate?
ethyl N-butan-2-yl-N-[(3,5-dichlorophenyl)sulfanylcarbamoyl]-N'-(dimethylcarbamoyl)carbamimidate has a molecular weight of 435.38 g/mol, XLogP of 4.88, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-butan-2-yl-N-[(3,5-dichlorophenyl)sulfanylcarbamoyl]-N'-(dimethylcarbamoyl)carbamimidate is sourced from PubChem (CID 173453197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).