About methyl N-[(3-chlorophenyl)sulfanylcarbamoyl]-N'-(dibutylcarbamoyl)-N-ethylcarbamimidate
methyl N-[(3-chlorophenyl)sulfanylcarbamoyl]-N'-(dibutylcarbamoyl)-N-ethylcarbamimidate (PubChem CID 173453249) has the molecular formula C20H31ClN4O3S
and a molecular weight of 443.01 g/mol. Its IUPAC name is methyl N-[(3-chlorophenyl)sulfanylcarbamoyl]-N'-(dibutylcarbamoyl)-N-ethylcarbamimidate.
Molecular Properties
| Compound Name | methyl N-[(3-chlorophenyl)sulfanylcarbamoyl]-N'-(dibutylcarbamoyl)-N-ethylcarbamimidate |
| PubChem CID | 173453249 |
| Molecular Formula | C20H31ClN4O3S |
| Molecular Weight | 443.01 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | methyl N-[(3-chlorophenyl)sulfanylcarbamoyl]-N'-(dibutylcarbamoyl)-N-ethylcarbamimidate |
| SMILES | CCCCN(CCCC)C(=O)N=C(OC)N(CC)C(=O)NSc1cccc(Cl)c1 |
| InChI | InChI=1S/C20H31ClN4O3S/c1-5-8-13-24(14-9-6-2)18(26)22-20(28-4)25(7-3)19(27)23-29-17-12-10-11-16(21)15-17/h10-12,15H,5-9,13-14H2,1-4H3,(H,23,27) |
| InChIKey | ZGDAJRJHOYOGLA-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 443.01 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl N-[(3-chlorophenyl)sulfanylcarbamoyl]-N'-(dibutylcarbamoyl)-N-ethylcarbamimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[(3-chlorophenyl)sulfanylcarbamoyl]-N'-(dibutylcarbamoyl)-N-ethylcarbamimidate?
The IUPAC name of methyl N-[(3-chlorophenyl)sulfanylcarbamoyl]-N'-(dibutylcarbamoyl)-N-ethylcarbamimidate (CID 173453249) is methyl N-[(3-chlorophenyl)sulfanylcarbamoyl]-N'-(dibutylcarbamoyl)-N-ethylcarbamimidate.
What is the SMILES notation for methyl N-[(3-chlorophenyl)sulfanylcarbamoyl]-N'-(dibutylcarbamoyl)-N-ethylcarbamimidate?
The canonical SMILES for methyl N-[(3-chlorophenyl)sulfanylcarbamoyl]-N'-(dibutylcarbamoyl)-N-ethylcarbamimidate is CCCCN(CCCC)C(=O)N=C(OC)N(CC)C(=O)NSc1cccc(Cl)c1.
What is the InChIKey of methyl N-[(3-chlorophenyl)sulfanylcarbamoyl]-N'-(dibutylcarbamoyl)-N-ethylcarbamimidate?
The InChIKey is ZGDAJRJHOYOGLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H31ClN4O3S/c1-5-8-13-24(14-9-6-2)18(26)22-20(28-4)25(7-3)19(27)23-29-17-12-10-11-16(21)15-17/h10-12,15H,5-9,13-14H2,1-4H3,(H,23,27).
What are the key properties of methyl N-[(3-chlorophenyl)sulfanylcarbamoyl]-N'-(dibutylcarbamoyl)-N-ethylcarbamimidate?
methyl N-[(3-chlorophenyl)sulfanylcarbamoyl]-N'-(dibutylcarbamoyl)-N-ethylcarbamimidate has a molecular weight of 443.01 g/mol, XLogP of 5.40, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[(3-chlorophenyl)sulfanylcarbamoyl]-N'-(dibutylcarbamoyl)-N-ethylcarbamimidate is sourced from PubChem (CID 173453249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).