About propan-2-yl N-butyl-N-[(3,5-dichlorophenyl)sulfanylcarbamoyl]-N'-(dimethylcarbamoyl)carbamimidate
propan-2-yl N-butyl-N-[(3,5-dichlorophenyl)sulfanylcarbamoyl]-N'-(dimethylcarbamoyl)carbamimidate (PubChem CID 173453363) has the molecular formula C18H26Cl2N4O3S
and a molecular weight of 449.40 g/mol. Its IUPAC name is propan-2-yl N-butyl-N-[(3,5-dichlorophenyl)sulfanylcarbamoyl]-N'-(dimethylcarbamoyl)carbamimidate.
Molecular Properties
| Compound Name | propan-2-yl N-butyl-N-[(3,5-dichlorophenyl)sulfanylcarbamoyl]-N'-(dimethylcarbamoyl)carbamimidate |
| PubChem CID | 173453363 |
| Molecular Formula | C18H26Cl2N4O3S |
| Molecular Weight | 449.40 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | propan-2-yl N-butyl-N-[(3,5-dichlorophenyl)sulfanylcarbamoyl]-N'-(dimethylcarbamoyl)carbamimidate |
| SMILES | CCCCN(C(=O)NSc1cc(Cl)cc(Cl)c1)C(=NC(=O)N(C)C)OC(C)C |
| InChI | InChI=1S/C18H26Cl2N4O3S/c1-6-7-8-24(18(27-12(2)3)21-16(25)23(4)5)17(26)22-28-15-10-13(19)9-14(20)11-15/h9-12H,6-8H2,1-5H3,(H,22,26) |
| InChIKey | FOSYWYITVAKXMA-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 449.40 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl N-butyl-N-[(3,5-dichlorophenyl)sulfanylcarbamoyl]-N'-(dimethylcarbamoyl)carbamimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl N-butyl-N-[(3,5-dichlorophenyl)sulfanylcarbamoyl]-N'-(dimethylcarbamoyl)carbamimidate?
The IUPAC name of propan-2-yl N-butyl-N-[(3,5-dichlorophenyl)sulfanylcarbamoyl]-N'-(dimethylcarbamoyl)carbamimidate (CID 173453363) is propan-2-yl N-butyl-N-[(3,5-dichlorophenyl)sulfanylcarbamoyl]-N'-(dimethylcarbamoyl)carbamimidate.
What is the SMILES notation for propan-2-yl N-butyl-N-[(3,5-dichlorophenyl)sulfanylcarbamoyl]-N'-(dimethylcarbamoyl)carbamimidate?
The canonical SMILES for propan-2-yl N-butyl-N-[(3,5-dichlorophenyl)sulfanylcarbamoyl]-N'-(dimethylcarbamoyl)carbamimidate is CCCCN(C(=O)NSc1cc(Cl)cc(Cl)c1)C(=NC(=O)N(C)C)OC(C)C.
What is the InChIKey of propan-2-yl N-butyl-N-[(3,5-dichlorophenyl)sulfanylcarbamoyl]-N'-(dimethylcarbamoyl)carbamimidate?
The InChIKey is FOSYWYITVAKXMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26Cl2N4O3S/c1-6-7-8-24(18(27-12(2)3)21-16(25)23(4)5)17(26)22-28-15-10-13(19)9-14(20)11-15/h9-12H,6-8H2,1-5H3,(H,22,26).
What are the key properties of propan-2-yl N-butyl-N-[(3,5-dichlorophenyl)sulfanylcarbamoyl]-N'-(dimethylcarbamoyl)carbamimidate?
propan-2-yl N-butyl-N-[(3,5-dichlorophenyl)sulfanylcarbamoyl]-N'-(dimethylcarbamoyl)carbamimidate has a molecular weight of 449.40 g/mol, XLogP of 5.27, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl N-butyl-N-[(3,5-dichlorophenyl)sulfanylcarbamoyl]-N'-(dimethylcarbamoyl)carbamimidate is sourced from PubChem (CID 173453363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).