About propyl N-[(3-chlorophenyl)sulfanylcarbamoyl]-N'-(dimethylcarbamoyl)-N-propan-2-ylcarbamimidate
propyl N-[(3-chlorophenyl)sulfanylcarbamoyl]-N'-(dimethylcarbamoyl)-N-propan-2-ylcarbamimidate (PubChem CID 173453440) has the molecular formula C17H25ClN4O3S
and a molecular weight of 400.93 g/mol. Its IUPAC name is propyl N-[(3-chlorophenyl)sulfanylcarbamoyl]-N'-(dimethylcarbamoyl)-N-propan-2-ylcarbamimidate.
Molecular Properties
| Compound Name | propyl N-[(3-chlorophenyl)sulfanylcarbamoyl]-N'-(dimethylcarbamoyl)-N-propan-2-ylcarbamimidate |
| PubChem CID | 173453440 |
| Molecular Formula | C17H25ClN4O3S |
| Molecular Weight | 400.93 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | propyl N-[(3-chlorophenyl)sulfanylcarbamoyl]-N'-(dimethylcarbamoyl)-N-propan-2-ylcarbamimidate |
| SMILES | CCCOC(=NC(=O)N(C)C)N(C(=O)NSc1cccc(Cl)c1)C(C)C |
| InChI | InChI=1S/C17H25ClN4O3S/c1-6-10-25-17(19-15(23)21(4)5)22(12(2)3)16(24)20-26-14-9-7-8-13(18)11-14/h7-9,11-12H,6,10H2,1-5H3,(H,20,24) |
| InChIKey | XXNOCTUMEJWNPA-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.93 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze propyl N-[(3-chlorophenyl)sulfanylcarbamoyl]-N'-(dimethylcarbamoyl)-N-propan-2-ylcarbamimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl N-[(3-chlorophenyl)sulfanylcarbamoyl]-N'-(dimethylcarbamoyl)-N-propan-2-ylcarbamimidate?
The IUPAC name of propyl N-[(3-chlorophenyl)sulfanylcarbamoyl]-N'-(dimethylcarbamoyl)-N-propan-2-ylcarbamimidate (CID 173453440) is propyl N-[(3-chlorophenyl)sulfanylcarbamoyl]-N'-(dimethylcarbamoyl)-N-propan-2-ylcarbamimidate.
What is the SMILES notation for propyl N-[(3-chlorophenyl)sulfanylcarbamoyl]-N'-(dimethylcarbamoyl)-N-propan-2-ylcarbamimidate?
The canonical SMILES for propyl N-[(3-chlorophenyl)sulfanylcarbamoyl]-N'-(dimethylcarbamoyl)-N-propan-2-ylcarbamimidate is CCCOC(=NC(=O)N(C)C)N(C(=O)NSc1cccc(Cl)c1)C(C)C.
What is the InChIKey of propyl N-[(3-chlorophenyl)sulfanylcarbamoyl]-N'-(dimethylcarbamoyl)-N-propan-2-ylcarbamimidate?
The InChIKey is XXNOCTUMEJWNPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25ClN4O3S/c1-6-10-25-17(19-15(23)21(4)5)22(12(2)3)16(24)20-26-14-9-7-8-13(18)11-14/h7-9,11-12H,6,10H2,1-5H3,(H,20,24).
What are the key properties of propyl N-[(3-chlorophenyl)sulfanylcarbamoyl]-N'-(dimethylcarbamoyl)-N-propan-2-ylcarbamimidate?
propyl N-[(3-chlorophenyl)sulfanylcarbamoyl]-N'-(dimethylcarbamoyl)-N-propan-2-ylcarbamimidate has a molecular weight of 400.93 g/mol, XLogP of 4.23, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propyl N-[(3-chlorophenyl)sulfanylcarbamoyl]-N'-(dimethylcarbamoyl)-N-propan-2-ylcarbamimidate is sourced from PubChem (CID 173453440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).