About zinc;3-chloro-4-pyrrolidin-1-ylbenzenediazonium;trichloride
zinc;3-chloro-4-pyrrolidin-1-ylbenzenediazonium;trichloride (PubChem CID 173454460) has the molecular formula C10H11Cl4N3Zn
and a molecular weight of 380.42 g/mol. Its IUPAC name is zinc;3-chloro-4-pyrrolidin-1-ylbenzenediazonium;trichloride.
Molecular Properties
| Compound Name | zinc;3-chloro-4-pyrrolidin-1-ylbenzenediazonium;trichloride |
| PubChem CID | 173454460 |
| Molecular Formula | C10H11Cl4N3Zn |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 376.90 |
| IUPAC Name | zinc;3-chloro-4-pyrrolidin-1-ylbenzenediazonium;trichloride |
| SMILES | N#[N+]c1ccc(N2CCCC2)c(Cl)c1.[Cl-].[Cl-].[Cl-].[Zn+2] |
| InChI | InChI=1S/C10H11ClN3.3ClH.Zn/c11-9-7-8(13-12)3-4-10(9)14-5-1-2-6-14;;;;/h3-4,7H,1-2,5-6H2;3*1H;/q+1;;;;+2/p-3 |
| InChIKey | KCYWFUVRJOGRTC-UHFFFAOYSA-K |
| XLogP | -5.57 |
| TPSA | 31.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | -5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc;3-chloro-4-pyrrolidin-1-ylbenzenediazonium;trichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;3-chloro-4-pyrrolidin-1-ylbenzenediazonium;trichloride?
The IUPAC name of zinc;3-chloro-4-pyrrolidin-1-ylbenzenediazonium;trichloride (CID 173454460) is zinc;3-chloro-4-pyrrolidin-1-ylbenzenediazonium;trichloride.
What is the SMILES notation for zinc;3-chloro-4-pyrrolidin-1-ylbenzenediazonium;trichloride?
The canonical SMILES for zinc;3-chloro-4-pyrrolidin-1-ylbenzenediazonium;trichloride is N#[N+]c1ccc(N2CCCC2)c(Cl)c1.[Cl-].[Cl-].[Cl-].[Zn+2].
What is the InChIKey of zinc;3-chloro-4-pyrrolidin-1-ylbenzenediazonium;trichloride?
The InChIKey is KCYWFUVRJOGRTC-UHFFFAOYSA-K. The full InChI is InChI=1S/C10H11ClN3.3ClH.Zn/c11-9-7-8(13-12)3-4-10(9)14-5-1-2-6-14;;;;/h3-4,7H,1-2,5-6H2;3*1H;/q+1;;;;+2/p-3.
What are the key properties of zinc;3-chloro-4-pyrrolidin-1-ylbenzenediazonium;trichloride?
zinc;3-chloro-4-pyrrolidin-1-ylbenzenediazonium;trichloride has a molecular weight of 380.42 g/mol, XLogP of -5.57, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;3-chloro-4-pyrrolidin-1-ylbenzenediazonium;trichloride is sourced from PubChem (CID 173454460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).