About (2-diethoxyphosphoryl-1,1,2-trimethoxyethyl)silane
(2-diethoxyphosphoryl-1,1,2-trimethoxyethyl)silane (PubChem CID 173454501) has the molecular formula C9H23O6PSi
and a molecular weight of 286.34 g/mol. Its IUPAC name is (2-diethoxyphosphoryl-1,1,2-trimethoxyethyl)silane.
Molecular Properties
| Compound Name | (2-diethoxyphosphoryl-1,1,2-trimethoxyethyl)silane |
| PubChem CID | 173454501 |
| Molecular Formula | C9H23O6PSi |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | (2-diethoxyphosphoryl-1,1,2-trimethoxyethyl)silane |
| SMILES | CCOP(=O)(OCC)C(OC)C([SiH3])(OC)OC |
| InChI | InChI=1S/C9H23O6PSi/c1-6-14-16(10,15-7-2)8(11-3)9(17,12-4)13-5/h8H,6-7H2,1-5,17H3 |
| InChIKey | HQNBPTUGWQKEBN-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2-diethoxyphosphoryl-1,1,2-trimethoxyethyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-diethoxyphosphoryl-1,1,2-trimethoxyethyl)silane?
The IUPAC name of (2-diethoxyphosphoryl-1,1,2-trimethoxyethyl)silane (CID 173454501) is (2-diethoxyphosphoryl-1,1,2-trimethoxyethyl)silane.
What is the SMILES notation for (2-diethoxyphosphoryl-1,1,2-trimethoxyethyl)silane?
The canonical SMILES for (2-diethoxyphosphoryl-1,1,2-trimethoxyethyl)silane is CCOP(=O)(OCC)C(OC)C([SiH3])(OC)OC.
What is the InChIKey of (2-diethoxyphosphoryl-1,1,2-trimethoxyethyl)silane?
The InChIKey is HQNBPTUGWQKEBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H23O6PSi/c1-6-14-16(10,15-7-2)8(11-3)9(17,12-4)13-5/h8H,6-7H2,1-5,17H3.
What are the key properties of (2-diethoxyphosphoryl-1,1,2-trimethoxyethyl)silane?
(2-diethoxyphosphoryl-1,1,2-trimethoxyethyl)silane has a molecular weight of 286.34 g/mol, XLogP of 0.54, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-diethoxyphosphoryl-1,1,2-trimethoxyethyl)silane is sourced from PubChem (CID 173454501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).