About 3-[4-(2-ethyl-3-methoxyisoindol-1-yl)but-3-enyl]-1,3-benzothiazol-3-ium perchlorate
3-[4-(2-ethyl-3-methoxyisoindol-1-yl)but-3-enyl]-1,3-benzothiazol-3-ium perchlorate (PubChem CID 173454717) has the molecular formula C22H23ClN2O5S
and a molecular weight of 462.96 g/mol. Its IUPAC name is 3-[4-(2-ethyl-3-methoxyisoindol-1-yl)but-3-enyl]-1,3-benzothiazol-3-ium perchlorate.
Molecular Properties
| Compound Name | 3-[4-(2-ethyl-3-methoxyisoindol-1-yl)but-3-enyl]-1,3-benzothiazol-3-ium perchlorate |
| PubChem CID | 173454717 |
| Molecular Formula | C22H23ClN2O5S |
| Molecular Weight | 462.96 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | 3-[4-(2-ethyl-3-methoxyisoindol-1-yl)but-3-enyl]-1,3-benzothiazol-3-ium perchlorate |
| SMILES | CCn1c(C=CCC[n+]2csc3ccccc32)c2ccccc2c1OC.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C22H23N2OS.ClHO4/c1-3-24-19(17-10-4-5-11-18(17)22(24)25-2)12-8-9-15-23-16-26-21-14-7-6-13-20(21)23;2-1(3,4)5/h4-8,10-14,16H,3,9,15H2,1-2H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | HHCLJGDFYSVASY-UHFFFAOYSA-M |
| XLogP | 0.52 |
| TPSA | 110.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 462.96 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-(2-ethyl-3-methoxyisoindol-1-yl)but-3-enyl]-1,3-benzothiazol-3-ium perchlorate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(2-ethyl-3-methoxyisoindol-1-yl)but-3-enyl]-1,3-benzothiazol-3-ium perchlorate?
The IUPAC name of 3-[4-(2-ethyl-3-methoxyisoindol-1-yl)but-3-enyl]-1,3-benzothiazol-3-ium perchlorate (CID 173454717) is 3-[4-(2-ethyl-3-methoxyisoindol-1-yl)but-3-enyl]-1,3-benzothiazol-3-ium perchlorate.
What is the SMILES notation for 3-[4-(2-ethyl-3-methoxyisoindol-1-yl)but-3-enyl]-1,3-benzothiazol-3-ium perchlorate?
The canonical SMILES for 3-[4-(2-ethyl-3-methoxyisoindol-1-yl)but-3-enyl]-1,3-benzothiazol-3-ium perchlorate is CCn1c(C=CCC[n+]2csc3ccccc32)c2ccccc2c1OC.[O-][Cl+3]([O-])([O-])[O-].
What is the InChIKey of 3-[4-(2-ethyl-3-methoxyisoindol-1-yl)but-3-enyl]-1,3-benzothiazol-3-ium perchlorate?
The InChIKey is HHCLJGDFYSVASY-UHFFFAOYSA-M. The full InChI is InChI=1S/C22H23N2OS.ClHO4/c1-3-24-19(17-10-4-5-11-18(17)22(24)25-2)12-8-9-15-23-16-26-21-14-7-6-13-20(21)23;2-1(3,4)5/h4-8,10-14,16H,3,9,15H2,1-2H3;(H,2,3,4,5)/q+1;/p-1.
What are the key properties of 3-[4-(2-ethyl-3-methoxyisoindol-1-yl)but-3-enyl]-1,3-benzothiazol-3-ium perchlorate?
3-[4-(2-ethyl-3-methoxyisoindol-1-yl)but-3-enyl]-1,3-benzothiazol-3-ium perchlorate has a molecular weight of 462.96 g/mol, XLogP of 0.52, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(2-ethyl-3-methoxyisoindol-1-yl)but-3-enyl]-1,3-benzothiazol-3-ium perchlorate is sourced from PubChem (CID 173454717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).