C61H116O6S3 — CID 173455078
methyl 2-(2-sulfanylethyl)octadec-9-enoate;bis(2-(2-sulfanylethyl)octadec-9-enoic acid) (PubChem CID 173455078) has the molecular formula C61H116O6S3 and a molecular weight of 1041.79 g/mol. Its IUPAC name is methyl 2-(2-sulfanylethyl)octadec-9-enoate;bis(2-(2-sulfanylethyl)octadec-9-enoic acid).
| Compound Name | methyl 2-(2-sulfanylethyl)octadec-9-enoate;bis(2-(2-sulfanylethyl)octadec-9-enoic acid) |
|---|---|
| PubChem CID | 173455078 |
| Molecular Formula | C61H116O6S3 |
| Molecular Weight | 1041.79 g/mol |
| Exact Mass | 1040.79 |
| IUPAC Name | methyl 2-(2-sulfanylethyl)octadec-9-enoate;bis(2-(2-sulfanylethyl)octadec-9-enoic acid) |
| SMILES | CCCCCCCCC=CCCCCCCC(CCS)C(=O)O.CCCCCCCCC=CCCCCCCC(CCS)C(=O)O.CCCCCCCCC=CCCCCCCC(CCS)C(=O)OC |
| InChI | InChI=1S/C21H40O2S.2C20H38O2S/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(18-19-24)21(22)23-2;2*1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19(17-18-23)20(21)22/h10-11,20,24H,3-9,12-19H2,1-2H3;2*9-10,19,23H,2-8,11-18H2,1H3,(H,21,22) |
| InChIKey | HUNQLANGMYQLOA-UHFFFAOYSA-N |
| XLogP | 20.05 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 51 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1041.79 |
| LogP ≤ 5 | 20.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|