C30H25BrN2O8S — CID 173455629
2-[3-(N-acetylanilino)-2-formylsulfanyl-4-oxoazetidin-1-yl]-4-bromo-3-hydroxybut-2-enoic acid;3,3-diphenyloxiran-2-one (PubChem CID 173455629) has the molecular formula C30H25BrN2O8S and a molecular weight of 653.51 g/mol. Its IUPAC name is 2-[3-(N-acetylanilino)-2-formylsulfanyl-4-oxoazetidin-1-yl]-4-bromo-3-hydroxybut-2-enoic acid;3,3-diphenyloxiran-2-one.
| Compound Name | 2-[3-(N-acetylanilino)-2-formylsulfanyl-4-oxoazetidin-1-yl]-4-bromo-3-hydroxybut-2-enoic acid;3,3-diphenyloxiran-2-one |
|---|---|
| PubChem CID | 173455629 |
| Molecular Formula | C30H25BrN2O8S |
| Molecular Weight | 653.51 g/mol |
| Exact Mass | 652.05 |
| IUPAC Name | 2-[3-(N-acetylanilino)-2-formylsulfanyl-4-oxoazetidin-1-yl]-4-bromo-3-hydroxybut-2-enoic acid;3,3-diphenyloxiran-2-one |
| SMILES | CC(=O)N(c1ccccc1)C1C(=O)N(C(C(=O)O)=C(O)CBr)C1SC=O.O=C1OC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H15BrN2O6S.C14H10O2/c1-9(21)18(10-5-3-2-4-6-10)13-14(23)19(15(13)26-8-20)12(16(24)25)11(22)7-17;15-13-14(16-13,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h2-6,8,13,15,22H,7H2,1H3,(H,24,25);1-10H |
| InChIKey | BLWYTEINHAXUIT-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 144.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.51 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|