About 3-(cyclohexen-1-yl)-1,2-dimethyl-5-phenylpyrazolidine;hydroiodide
3-(cyclohexen-1-yl)-1,2-dimethyl-5-phenylpyrazolidine;hydroiodide (PubChem CID 173456626) has the molecular formula C17H25IN2
and a molecular weight of 384.31 g/mol. Its IUPAC name is 3-(cyclohexen-1-yl)-1,2-dimethyl-5-phenylpyrazolidine;hydroiodide.
Molecular Properties
| Compound Name | 3-(cyclohexen-1-yl)-1,2-dimethyl-5-phenylpyrazolidine;hydroiodide |
| PubChem CID | 173456626 |
| Molecular Formula | C17H25IN2 |
| Molecular Weight | 384.31 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 3-(cyclohexen-1-yl)-1,2-dimethyl-5-phenylpyrazolidine;hydroiodide |
| SMILES | CN1C(C2=CCCCC2)CC(c2ccccc2)N1C.I |
| InChI | InChI=1S/C17H24N2.HI/c1-18-16(14-9-5-3-6-10-14)13-17(19(18)2)15-11-7-4-8-12-15;/h3,5-6,9-11,16-17H,4,7-8,12-13H2,1-2H3;1H |
| InChIKey | MECOWVXGBRCEID-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.31 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(cyclohexen-1-yl)-1,2-dimethyl-5-phenylpyrazolidine;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(cyclohexen-1-yl)-1,2-dimethyl-5-phenylpyrazolidine;hydroiodide?
The IUPAC name of 3-(cyclohexen-1-yl)-1,2-dimethyl-5-phenylpyrazolidine;hydroiodide (CID 173456626) is 3-(cyclohexen-1-yl)-1,2-dimethyl-5-phenylpyrazolidine;hydroiodide.
What is the SMILES notation for 3-(cyclohexen-1-yl)-1,2-dimethyl-5-phenylpyrazolidine;hydroiodide?
The canonical SMILES for 3-(cyclohexen-1-yl)-1,2-dimethyl-5-phenylpyrazolidine;hydroiodide is CN1C(C2=CCCCC2)CC(c2ccccc2)N1C.I.
What is the InChIKey of 3-(cyclohexen-1-yl)-1,2-dimethyl-5-phenylpyrazolidine;hydroiodide?
The InChIKey is MECOWVXGBRCEID-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N2.HI/c1-18-16(14-9-5-3-6-10-14)13-17(19(18)2)15-11-7-4-8-12-15;/h3,5-6,9-11,16-17H,4,7-8,12-13H2,1-2H3;1H.
What are the key properties of 3-(cyclohexen-1-yl)-1,2-dimethyl-5-phenylpyrazolidine;hydroiodide?
3-(cyclohexen-1-yl)-1,2-dimethyl-5-phenylpyrazolidine;hydroiodide has a molecular weight of 384.31 g/mol, XLogP of 4.40, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(cyclohexen-1-yl)-1,2-dimethyl-5-phenylpyrazolidine;hydroiodide is sourced from PubChem (CID 173456626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).