About dioxido(oxo)germane;dioxido(oxo)silane;bis(lead(2+))
dioxido(oxo)germane;dioxido(oxo)silane;bis(lead(2+)) (PubChem CID 173456693) has the molecular formula GeO6Pb2Si
and a molecular weight of 611.09 g/mol. Its IUPAC name is dioxido(oxo)germane;dioxido(oxo)silane;bis(lead(2+)).
Molecular Properties
| Compound Name | dioxido(oxo)germane;dioxido(oxo)silane;bis(lead(2+)) |
| PubChem CID | 173456693 |
| Molecular Formula | GeO6Pb2Si |
| Molecular Weight | 611.09 g/mol |
| Exact Mass | 613.82 |
| IUPAC Name | dioxido(oxo)germane;dioxido(oxo)silane;bis(lead(2+)) |
| SMILES | O=[Ge]([O-])[O-].O=[Si]([O-])[O-].[Pb+2].[Pb+2] |
| InChI | InChI=1S/GeO3.O3Si.2Pb/c2-1(3)4;1-4(2)3;;/q2*-2;2*+2 |
| InChIKey | YJTRSWIZAHRMBA-UHFFFAOYSA-N |
| XLogP | -6.52 |
| TPSA | 126.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 611.09 |
| LogP ≤ 5 | -6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dioxido(oxo)germane;dioxido(oxo)silane;bis(lead(2+)) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioxido(oxo)germane;dioxido(oxo)silane;bis(lead(2+))?
The IUPAC name of dioxido(oxo)germane;dioxido(oxo)silane;bis(lead(2+)) (CID 173456693) is dioxido(oxo)germane;dioxido(oxo)silane;bis(lead(2+)).
What is the SMILES notation for dioxido(oxo)germane;dioxido(oxo)silane;bis(lead(2+))?
The canonical SMILES for dioxido(oxo)germane;dioxido(oxo)silane;bis(lead(2+)) is O=[Ge]([O-])[O-].O=[Si]([O-])[O-].[Pb+2].[Pb+2].
What is the InChIKey of dioxido(oxo)germane;dioxido(oxo)silane;bis(lead(2+))?
The InChIKey is YJTRSWIZAHRMBA-UHFFFAOYSA-N. The full InChI is InChI=1S/GeO3.O3Si.2Pb/c2-1(3)4;1-4(2)3;;/q2*-2;2*+2.
What are the key properties of dioxido(oxo)germane;dioxido(oxo)silane;bis(lead(2+))?
dioxido(oxo)germane;dioxido(oxo)silane;bis(lead(2+)) has a molecular weight of 611.09 g/mol, XLogP of -6.52, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dioxido(oxo)germane;dioxido(oxo)silane;bis(lead(2+)) is sourced from PubChem (CID 173456693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).