About N,N-diethylethanamine;methyl(1H-pyrrol-2-yl)carbamodithioic acid
N,N-diethylethanamine;methyl(1H-pyrrol-2-yl)carbamodithioic acid (PubChem CID 173456741) has the molecular formula C12H23N3S2
and a molecular weight of 273.47 g/mol. Its IUPAC name is N,N-diethylethanamine;methyl(1H-pyrrol-2-yl)carbamodithioic acid.
Molecular Properties
| Compound Name | N,N-diethylethanamine;methyl(1H-pyrrol-2-yl)carbamodithioic acid |
| PubChem CID | 173456741 |
| Molecular Formula | C12H23N3S2 |
| Molecular Weight | 273.47 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | N,N-diethylethanamine;methyl(1H-pyrrol-2-yl)carbamodithioic acid |
| SMILES | CCN(CC)CC.CN(C(=S)S)c1ccc[nH]1 |
| InChI | InChI=1S/C6H8N2S2.C6H15N/c1-8(6(9)10)5-3-2-4-7-5;1-4-7(5-2)6-3/h2-4,7H,1H3,(H,9,10);4-6H2,1-3H3 |
| InChIKey | ZVGOSBRDLYOUSA-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 22.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.47 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze N,N-diethylethanamine;methyl(1H-pyrrol-2-yl)carbamodithioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethylethanamine;methyl(1H-pyrrol-2-yl)carbamodithioic acid?
The IUPAC name of N,N-diethylethanamine;methyl(1H-pyrrol-2-yl)carbamodithioic acid (CID 173456741) is N,N-diethylethanamine;methyl(1H-pyrrol-2-yl)carbamodithioic acid.
What is the SMILES notation for N,N-diethylethanamine;methyl(1H-pyrrol-2-yl)carbamodithioic acid?
The canonical SMILES for N,N-diethylethanamine;methyl(1H-pyrrol-2-yl)carbamodithioic acid is CCN(CC)CC.CN(C(=S)S)c1ccc[nH]1.
What is the InChIKey of N,N-diethylethanamine;methyl(1H-pyrrol-2-yl)carbamodithioic acid?
The InChIKey is ZVGOSBRDLYOUSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2S2.C6H15N/c1-8(6(9)10)5-3-2-4-7-5;1-4-7(5-2)6-3/h2-4,7H,1H3,(H,9,10);4-6H2,1-3H3.
What are the key properties of N,N-diethylethanamine;methyl(1H-pyrrol-2-yl)carbamodithioic acid?
N,N-diethylethanamine;methyl(1H-pyrrol-2-yl)carbamodithioic acid has a molecular weight of 273.47 g/mol, XLogP of 3.01, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylethanamine;methyl(1H-pyrrol-2-yl)carbamodithioic acid is sourced from PubChem (CID 173456741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).