About propanoyloxy-λ2-stannane
propanoyloxy-λ2-stannane (PubChem CID 173456890) has the molecular formula C3H6O2Sn
and a molecular weight of 192.79 g/mol. Its IUPAC name is propanoyloxy-λ2-stannane.
Molecular Properties
| Compound Name | propanoyloxy-λ2-stannane |
| PubChem CID | 173456890 |
| Molecular Formula | C3H6O2Sn |
| Molecular Weight | 192.79 g/mol |
| Exact Mass | 193.94 |
| IUPAC Name | propanoyloxy-λ2-stannane |
| SMILES | CCC(=O)O[SnH] |
| InChI | InChI=1S/C3H6O2.Sn.H/c1-2-3(4)5;;/h2H2,1H3,(H,4,5);;/q;+1;/p-1 |
| InChIKey | XGHLCEODRRBKFD-UHFFFAOYSA-M |
| XLogP | -0.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.79 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze propanoyloxy-λ2-stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propanoyloxy-λ2-stannane?
The IUPAC name of propanoyloxy-λ2-stannane (CID 173456890) is propanoyloxy-λ2-stannane.
What is the SMILES notation for propanoyloxy-λ2-stannane?
The canonical SMILES for propanoyloxy-λ2-stannane is CCC(=O)O[SnH].
What is the InChIKey of propanoyloxy-λ2-stannane?
The InChIKey is XGHLCEODRRBKFD-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H6O2.Sn.H/c1-2-3(4)5;;/h2H2,1H3,(H,4,5);;/q;+1;/p-1.
What are the key properties of propanoyloxy-λ2-stannane?
propanoyloxy-λ2-stannane has a molecular weight of 192.79 g/mol, XLogP of -0.24, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propanoyloxy-λ2-stannane is sourced from PubChem (CID 173456890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).