About cyclohexyl(dicyclopentyl)sulfanium;iodide;hydroiodide
cyclohexyl(dicyclopentyl)sulfanium;iodide;hydroiodide (PubChem CID 173457122) has the molecular formula C16H30I2S
and a molecular weight of 508.29 g/mol. Its IUPAC name is cyclohexyl(dicyclopentyl)sulfanium;iodide;hydroiodide.
Molecular Properties
| Compound Name | cyclohexyl(dicyclopentyl)sulfanium;iodide;hydroiodide |
| PubChem CID | 173457122 |
| Molecular Formula | C16H30I2S |
| Molecular Weight | 508.29 g/mol |
| Exact Mass | 508.02 |
| IUPAC Name | cyclohexyl(dicyclopentyl)sulfanium;iodide;hydroiodide |
| SMILES | C1CCC([S+](C2CCCC2)C2CCCC2)CC1.I.[I-] |
| InChI | InChI=1S/C16H29S.2HI/c1-2-8-14(9-3-1)17(15-10-4-5-11-15)16-12-6-7-13-16;;/h14-16H,1-13H2;2*1H/q+1;;/p-1 |
| InChIKey | PERCPVWPNYSYGN-UHFFFAOYSA-M |
| XLogP | 2.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 508.29 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze cyclohexyl(dicyclopentyl)sulfanium;iodide;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl(dicyclopentyl)sulfanium;iodide;hydroiodide?
The IUPAC name of cyclohexyl(dicyclopentyl)sulfanium;iodide;hydroiodide (CID 173457122) is cyclohexyl(dicyclopentyl)sulfanium;iodide;hydroiodide.
What is the SMILES notation for cyclohexyl(dicyclopentyl)sulfanium;iodide;hydroiodide?
The canonical SMILES for cyclohexyl(dicyclopentyl)sulfanium;iodide;hydroiodide is C1CCC([S+](C2CCCC2)C2CCCC2)CC1.I.[I-].
What is the InChIKey of cyclohexyl(dicyclopentyl)sulfanium;iodide;hydroiodide?
The InChIKey is PERCPVWPNYSYGN-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H29S.2HI/c1-2-8-14(9-3-1)17(15-10-4-5-11-15)16-12-6-7-13-16;;/h14-16H,1-13H2;2*1H/q+1;;/p-1.
What are the key properties of cyclohexyl(dicyclopentyl)sulfanium;iodide;hydroiodide?
cyclohexyl(dicyclopentyl)sulfanium;iodide;hydroiodide has a molecular weight of 508.29 g/mol, XLogP of 2.44, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl(dicyclopentyl)sulfanium;iodide;hydroiodide is sourced from PubChem (CID 173457122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).