About germane;pentyl 2-pentylheptanoate
germane;pentyl 2-pentylheptanoate (PubChem CID 173457558) has the molecular formula C17H38GeO2
and a molecular weight of 347.10 g/mol. Its IUPAC name is germane;pentyl 2-pentylheptanoate.
Molecular Properties
| Compound Name | germane;pentyl 2-pentylheptanoate |
| PubChem CID | 173457558 |
| Molecular Formula | C17H38GeO2 |
| Molecular Weight | 347.10 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | germane;pentyl 2-pentylheptanoate |
| SMILES | CCCCCOC(=O)C(CCCCC)CCCCC.[GeH4] |
| InChI | InChI=1S/C17H34O2.GeH4/c1-4-7-10-13-16(14-11-8-5-2)17(18)19-15-12-9-6-3;/h16H,4-15H2,1-3H3;1H4 |
| InChIKey | LBJKTIMKOSLVSF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.10 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze germane;pentyl 2-pentylheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of germane;pentyl 2-pentylheptanoate?
The IUPAC name of germane;pentyl 2-pentylheptanoate (CID 173457558) is germane;pentyl 2-pentylheptanoate.
What is the SMILES notation for germane;pentyl 2-pentylheptanoate?
The canonical SMILES for germane;pentyl 2-pentylheptanoate is CCCCCOC(=O)C(CCCCC)CCCCC.[GeH4].
What is the InChIKey of germane;pentyl 2-pentylheptanoate?
The InChIKey is LBJKTIMKOSLVSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34O2.GeH4/c1-4-7-10-13-16(14-11-8-5-2)17(18)19-15-12-9-6-3;/h16H,4-15H2,1-3H3;1H4.
What are the key properties of germane;pentyl 2-pentylheptanoate?
germane;pentyl 2-pentylheptanoate has a molecular weight of 347.10 g/mol, XLogP of 4.05, 13 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for germane;pentyl 2-pentylheptanoate is sourced from PubChem (CID 173457558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).