About N,N-dimethyl-[(2S,3R)-3-methyloxiran-2-yl]phosphonamidic acid;N-methylmethanamine
N,N-dimethyl-[(2S,3R)-3-methyloxiran-2-yl]phosphonamidic acid;N-methylmethanamine (PubChem CID 173458386) has the molecular formula C7H19N2O3P
and a molecular weight of 210.21 g/mol. Its IUPAC name is N,N-dimethyl-[(2S,3R)-3-methyloxiran-2-yl]phosphonamidic acid;N-methylmethanamine.
Molecular Properties
| Compound Name | N,N-dimethyl-[(2S,3R)-3-methyloxiran-2-yl]phosphonamidic acid;N-methylmethanamine |
| PubChem CID | 173458386 |
| Molecular Formula | C7H19N2O3P |
| Molecular Weight | 210.21 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | N,N-dimethyl-[(2S,3R)-3-methyloxiran-2-yl]phosphonamidic acid;N-methylmethanamine |
| SMILES | CNC.C[C@H]1O[C@H]1P(=O)(O)N(C)C |
| InChI | InChI=1S/C5H12NO3P.C2H7N/c1-4-5(9-4)10(7,8)6(2)3;1-3-2/h4-5H,1-3H3,(H,7,8);3H,1-2H3/t4-,5+;/m1./s1 |
| InChIKey | KLKRETZMJCXMGJ-JBUOLDKXSA-N |
| XLogP | 0.31 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.21 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethyl-[(2S,3R)-3-methyloxiran-2-yl]phosphonamidic acid;N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-[(2S,3R)-3-methyloxiran-2-yl]phosphonamidic acid;N-methylmethanamine?
The IUPAC name of N,N-dimethyl-[(2S,3R)-3-methyloxiran-2-yl]phosphonamidic acid;N-methylmethanamine (CID 173458386) is N,N-dimethyl-[(2S,3R)-3-methyloxiran-2-yl]phosphonamidic acid;N-methylmethanamine.
What is the SMILES notation for N,N-dimethyl-[(2S,3R)-3-methyloxiran-2-yl]phosphonamidic acid;N-methylmethanamine?
The canonical SMILES for N,N-dimethyl-[(2S,3R)-3-methyloxiran-2-yl]phosphonamidic acid;N-methylmethanamine is CNC.C[C@H]1O[C@H]1P(=O)(O)N(C)C.
What is the InChIKey of N,N-dimethyl-[(2S,3R)-3-methyloxiran-2-yl]phosphonamidic acid;N-methylmethanamine?
The InChIKey is KLKRETZMJCXMGJ-JBUOLDKXSA-N. The full InChI is InChI=1S/C5H12NO3P.C2H7N/c1-4-5(9-4)10(7,8)6(2)3;1-3-2/h4-5H,1-3H3,(H,7,8);3H,1-2H3/t4-,5+;/m1./s1.
What are the key properties of N,N-dimethyl-[(2S,3R)-3-methyloxiran-2-yl]phosphonamidic acid;N-methylmethanamine?
N,N-dimethyl-[(2S,3R)-3-methyloxiran-2-yl]phosphonamidic acid;N-methylmethanamine has a molecular weight of 210.21 g/mol, XLogP of 0.31, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-[(2S,3R)-3-methyloxiran-2-yl]phosphonamidic acid;N-methylmethanamine is sourced from PubChem (CID 173458386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).