C14H31IN2 — CID 173458444
1,3-dimethyl-2-nonylimidazolidine;hydroiodide (PubChem CID 173458444) has the molecular formula C14H31IN2 and a molecular weight of 354.32 g/mol. Its IUPAC name is 1,3-dimethyl-2-nonylimidazolidine;hydroiodide.
| Compound Name | 1,3-dimethyl-2-nonylimidazolidine;hydroiodide |
|---|---|
| PubChem CID | 173458444 |
| Molecular Formula | C14H31IN2 |
| Molecular Weight | 354.32 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 1,3-dimethyl-2-nonylimidazolidine;hydroiodide |
| SMILES | CCCCCCCCCC1N(C)CCN1C.I |
| InChI | InChI=1S/C14H30N2.HI/c1-4-5-6-7-8-9-10-11-14-15(2)12-13-16(14)3;/h14H,4-13H2,1-3H3;1H |
| InChIKey | OGPRNSWAWMNNIR-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.32 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|