C33H62N12 — CID 173458921
8-methyl-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane-5,6,7,35-tetramine (PubChem CID 173458921) has the molecular formula C33H62N12 and a molecular weight of 626.94 g/mol. Its IUPAC name is 8-methyl-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane-5,6,7,35-tetramine.
| Compound Name | 8-methyl-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane-5,6,7,35-tetramine |
|---|---|
| PubChem CID | 173458921 |
| Molecular Formula | C33H62N12 |
| Molecular Weight | 626.94 g/mol |
| Exact Mass | 626.52 |
| IUPAC Name | 8-methyl-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane-5,6,7,35-tetramine |
| SMILES | CC1C(N)C(N)C(N)C2C3NC4NC(NC5NC(NC6NC(NC(N3)C12)C1CCCCC61)C1CCCCC51)C1CCCC(N)C41 |
| InChI | InChI=1S/C33H62N12/c1-13-20-22(24(36)25(37)23(13)35)33-44-31(20)42-29-17-10-5-4-9-16(17)27(40-29)38-26-14-7-2-3-8-15(14)28(39-26)41-30-18-11-6-12-19(34)21(18)32(43-30)45-33/h13-33,38-45H,2-12,34-37H2,1H3 |
| InChIKey | VYUDCWWOTCOAHG-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 200.32 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.94 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 12 |