About CID 173459381
CID 173459381 (PubChem CID 173459381) has the molecular formula C5H14N4NaS
and a molecular weight of 185.25 g/mol.
Molecular Properties
| Compound Name | CID 173459381 |
| PubChem CID | 173459381 |
| Molecular Formula | C5H14N4NaS |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | — |
| SMILES | CCN(CC)NC(=S)NN.[Na] |
| InChI | InChI=1S/C5H14N4S.Na/c1-3-9(4-2)8-5(10)7-6;/h3-4,6H2,1-2H3,(H2,7,8,10); |
| InChIKey | VVMMLLGBRFKPGP-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze CID 173459381 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173459381?
The IUPAC name of CID 173459381 (CID 173459381) is not available.
What is the SMILES notation for CID 173459381?
The canonical SMILES for CID 173459381 is CCN(CC)NC(=S)NN.[Na].
What is the InChIKey of CID 173459381?
The InChIKey is VVMMLLGBRFKPGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H14N4S.Na/c1-3-9(4-2)8-5(10)7-6;/h3-4,6H2,1-2H3,(H2,7,8,10);.
What are the key properties of CID 173459381?
CID 173459381 has a molecular weight of 185.25 g/mol, XLogP of -0.80, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173459381 is sourced from PubChem (CID 173459381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).