About 4-[4-[2-(1,3,3-trimethyl-2H-indol-2-yl)ethenyl]phenyl]morpholine;hydrochloride
4-[4-[2-(1,3,3-trimethyl-2H-indol-2-yl)ethenyl]phenyl]morpholine;hydrochloride (PubChem CID 173459830) has the molecular formula C23H29ClN2O
and a molecular weight of 384.95 g/mol. Its IUPAC name is 4-[4-[2-(1,3,3-trimethyl-2H-indol-2-yl)ethenyl]phenyl]morpholine;hydrochloride.
Molecular Properties
| Compound Name | 4-[4-[2-(1,3,3-trimethyl-2H-indol-2-yl)ethenyl]phenyl]morpholine;hydrochloride |
| PubChem CID | 173459830 |
| Molecular Formula | C23H29ClN2O |
| Molecular Weight | 384.95 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 4-[4-[2-(1,3,3-trimethyl-2H-indol-2-yl)ethenyl]phenyl]morpholine;hydrochloride |
| SMILES | CN1c2ccccc2C(C)(C)C1C=Cc1ccc(N2CCOCC2)cc1.Cl |
| InChI | InChI=1S/C23H28N2O.ClH/c1-23(2)20-6-4-5-7-21(20)24(3)22(23)13-10-18-8-11-19(12-9-18)25-14-16-26-17-15-25;/h4-13,22H,14-17H2,1-3H3;1H |
| InChIKey | LYSRSDAEKBVDHZ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.95 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-[2-(1,3,3-trimethyl-2H-indol-2-yl)ethenyl]phenyl]morpholine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[2-(1,3,3-trimethyl-2H-indol-2-yl)ethenyl]phenyl]morpholine;hydrochloride?
The IUPAC name of 4-[4-[2-(1,3,3-trimethyl-2H-indol-2-yl)ethenyl]phenyl]morpholine;hydrochloride (CID 173459830) is 4-[4-[2-(1,3,3-trimethyl-2H-indol-2-yl)ethenyl]phenyl]morpholine;hydrochloride.
What is the SMILES notation for 4-[4-[2-(1,3,3-trimethyl-2H-indol-2-yl)ethenyl]phenyl]morpholine;hydrochloride?
The canonical SMILES for 4-[4-[2-(1,3,3-trimethyl-2H-indol-2-yl)ethenyl]phenyl]morpholine;hydrochloride is CN1c2ccccc2C(C)(C)C1C=Cc1ccc(N2CCOCC2)cc1.Cl.
What is the InChIKey of 4-[4-[2-(1,3,3-trimethyl-2H-indol-2-yl)ethenyl]phenyl]morpholine;hydrochloride?
The InChIKey is LYSRSDAEKBVDHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28N2O.ClH/c1-23(2)20-6-4-5-7-21(20)24(3)22(23)13-10-18-8-11-19(12-9-18)25-14-16-26-17-15-25;/h4-13,22H,14-17H2,1-3H3;1H.
What are the key properties of 4-[4-[2-(1,3,3-trimethyl-2H-indol-2-yl)ethenyl]phenyl]morpholine;hydrochloride?
4-[4-[2-(1,3,3-trimethyl-2H-indol-2-yl)ethenyl]phenyl]morpholine;hydrochloride has a molecular weight of 384.95 g/mol, XLogP of 4.75, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[2-(1,3,3-trimethyl-2H-indol-2-yl)ethenyl]phenyl]morpholine;hydrochloride is sourced from PubChem (CID 173459830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).