About 2-amino-N-methoxy-2-oxoethanimidoyl cyanide;pyrrolidin-2-one
2-amino-N-methoxy-2-oxoethanimidoyl cyanide;pyrrolidin-2-one (PubChem CID 173459928) has the molecular formula C8H12N4O3
and a molecular weight of 212.21 g/mol. Its IUPAC name is 2-amino-N-methoxy-2-oxoethanimidoyl cyanide;pyrrolidin-2-one.
Molecular Properties
| Compound Name | 2-amino-N-methoxy-2-oxoethanimidoyl cyanide;pyrrolidin-2-one |
| PubChem CID | 173459928 |
| Molecular Formula | C8H12N4O3 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | 2-amino-N-methoxy-2-oxoethanimidoyl cyanide;pyrrolidin-2-one |
| SMILES | CON=C(C#N)C(N)=O.O=C1CCCN1 |
| InChI | InChI=1S/C4H5N3O2.C4H7NO/c1-9-7-3(2-5)4(6)8;6-4-2-1-3-5-4/h1H3,(H2,6,8);1-3H2,(H,5,6) |
| InChIKey | VWDWMVDAPRJQTI-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 117.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-N-methoxy-2-oxoethanimidoyl cyanide;pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-methoxy-2-oxoethanimidoyl cyanide;pyrrolidin-2-one?
The IUPAC name of 2-amino-N-methoxy-2-oxoethanimidoyl cyanide;pyrrolidin-2-one (CID 173459928) is 2-amino-N-methoxy-2-oxoethanimidoyl cyanide;pyrrolidin-2-one.
What is the SMILES notation for 2-amino-N-methoxy-2-oxoethanimidoyl cyanide;pyrrolidin-2-one?
The canonical SMILES for 2-amino-N-methoxy-2-oxoethanimidoyl cyanide;pyrrolidin-2-one is CON=C(C#N)C(N)=O.O=C1CCCN1.
What is the InChIKey of 2-amino-N-methoxy-2-oxoethanimidoyl cyanide;pyrrolidin-2-one?
The InChIKey is VWDWMVDAPRJQTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5N3O2.C4H7NO/c1-9-7-3(2-5)4(6)8;6-4-2-1-3-5-4/h1H3,(H2,6,8);1-3H2,(H,5,6).
What are the key properties of 2-amino-N-methoxy-2-oxoethanimidoyl cyanide;pyrrolidin-2-one?
2-amino-N-methoxy-2-oxoethanimidoyl cyanide;pyrrolidin-2-one has a molecular weight of 212.21 g/mol, XLogP of -1.11, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-methoxy-2-oxoethanimidoyl cyanide;pyrrolidin-2-one is sourced from PubChem (CID 173459928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).