About 2-(2-fluoro-2,2-dinitroethyl)-4,4-dinitropentanal
2-(2-fluoro-2,2-dinitroethyl)-4,4-dinitropentanal (PubChem CID 173460104) has the molecular formula C7H9FN4O9
and a molecular weight of 312.17 g/mol. Its IUPAC name is 2-(2-fluoro-2,2-dinitroethyl)-4,4-dinitropentanal.
Molecular Properties
| Compound Name | 2-(2-fluoro-2,2-dinitroethyl)-4,4-dinitropentanal |
| PubChem CID | 173460104 |
| Molecular Formula | C7H9FN4O9 |
| Molecular Weight | 312.17 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 2-(2-fluoro-2,2-dinitroethyl)-4,4-dinitropentanal |
| SMILES | CC(CC(C=O)CC(F)([N+](=O)[O-])[N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C7H9FN4O9/c1-6(9(14)15,10(16)17)2-5(4-13)3-7(8,11(18)19)12(20)21/h4-5H,2-3H2,1H3 |
| InChIKey | IHZFKGLVWQOGAJ-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 189.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.17 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-fluoro-2,2-dinitroethyl)-4,4-dinitropentanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-fluoro-2,2-dinitroethyl)-4,4-dinitropentanal?
The IUPAC name of 2-(2-fluoro-2,2-dinitroethyl)-4,4-dinitropentanal (CID 173460104) is 2-(2-fluoro-2,2-dinitroethyl)-4,4-dinitropentanal.
What is the SMILES notation for 2-(2-fluoro-2,2-dinitroethyl)-4,4-dinitropentanal?
The canonical SMILES for 2-(2-fluoro-2,2-dinitroethyl)-4,4-dinitropentanal is CC(CC(C=O)CC(F)([N+](=O)[O-])[N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-].
What is the InChIKey of 2-(2-fluoro-2,2-dinitroethyl)-4,4-dinitropentanal?
The InChIKey is IHZFKGLVWQOGAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9FN4O9/c1-6(9(14)15,10(16)17)2-5(4-13)3-7(8,11(18)19)12(20)21/h4-5H,2-3H2,1H3.
What are the key properties of 2-(2-fluoro-2,2-dinitroethyl)-4,4-dinitropentanal?
2-(2-fluoro-2,2-dinitroethyl)-4,4-dinitropentanal has a molecular weight of 312.17 g/mol, XLogP of 0.03, 9 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-fluoro-2,2-dinitroethyl)-4,4-dinitropentanal is sourced from PubChem (CID 173460104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).