C15H14N3O4S+ — CID 173460292
(2-methyl-1,1,4-trioxo-3H-1λ6,2-benzothiazine-3-carbonyl)-pyridin-2-ylazanium (PubChem CID 173460292) has the molecular formula C15H14N3O4S+ and a molecular weight of 332.36 g/mol. Its IUPAC name is (2-methyl-1,1,4-trioxo-3H-1λ6,2-benzothiazine-3-carbonyl)-pyridin-2-ylazanium.
| Compound Name | (2-methyl-1,1,4-trioxo-3H-1λ6,2-benzothiazine-3-carbonyl)-pyridin-2-ylazanium |
|---|---|
| PubChem CID | 173460292 |
| Molecular Formula | C15H14N3O4S+ |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | (2-methyl-1,1,4-trioxo-3H-1λ6,2-benzothiazine-3-carbonyl)-pyridin-2-ylazanium |
| SMILES | CN1C(C(=O)[NH2+]c2ccccn2)C(=O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C15H13N3O4S/c1-18-13(15(20)17-12-8-4-5-9-16-12)14(19)10-6-2-3-7-11(10)23(18,21)22/h2-9,13H,1H3,(H,16,17,20)/p+1 |
| InChIKey | MNSCVRXKDINXEY-UHFFFAOYSA-O |
| XLogP | -0.31 |
| TPSA | 101.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|