C37H40OP+ — CID 173460684
[2,6-dimethyl-8-(2,6,6-trimethyl-4-oxocyclohex-2-en-1-ylidene)octa-2,4,6-trienyl]-triphenylphosphanium (PubChem CID 173460684) has the molecular formula C37H40OP+ and a molecular weight of 531.70 g/mol. Its IUPAC name is [2,6-dimethyl-8-(2,6,6-trimethyl-4-oxocyclohex-2-en-1-ylidene)octa-2,4,6-trienyl]-triphenylphosphanium.
| Compound Name | [2,6-dimethyl-8-(2,6,6-trimethyl-4-oxocyclohex-2-en-1-ylidene)octa-2,4,6-trienyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 173460684 |
| Molecular Formula | C37H40OP+ |
| Molecular Weight | 531.70 g/mol |
| Exact Mass | 531.28 |
| IUPAC Name | [2,6-dimethyl-8-(2,6,6-trimethyl-4-oxocyclohex-2-en-1-ylidene)octa-2,4,6-trienyl]-triphenylphosphanium |
| SMILES | CC(C=CC=C(C)C[P+](c1ccccc1)(c1ccccc1)c1ccccc1)=CC=C1C(C)=CC(=O)CC1(C)C |
| InChI | InChI=1S/C37H40OP/c1-29(24-25-36-31(3)26-32(38)27-37(36,4)5)16-15-17-30(2)28-39(33-18-9-6-10-19-33,34-20-11-7-12-21-34)35-22-13-8-14-23-35/h6-26H,27-28H2,1-5H3/q+1 |
| InChIKey | YUAIQHHFKMSWRC-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.70 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|