C26H46BrNO2 — CID 173460947
butyl 3-amino-3-benzyl-2,2-dibutylheptanoate;hydrobromide (PubChem CID 173460947) has the molecular formula C26H46BrNO2 and a molecular weight of 484.56 g/mol. Its IUPAC name is butyl 3-amino-3-benzyl-2,2-dibutylheptanoate;hydrobromide.
| Compound Name | butyl 3-amino-3-benzyl-2,2-dibutylheptanoate;hydrobromide |
|---|---|
| PubChem CID | 173460947 |
| Molecular Formula | C26H46BrNO2 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 483.27 |
| IUPAC Name | butyl 3-amino-3-benzyl-2,2-dibutylheptanoate;hydrobromide |
| SMILES | Br.CCCCOC(=O)C(CCCC)(CCCC)C(N)(CCCC)Cc1ccccc1 |
| InChI | InChI=1S/C26H45NO2.BrH/c1-5-9-18-25(19-10-6-2,24(28)29-21-12-8-4)26(27,20-11-7-3)22-23-16-14-13-15-17-23;/h13-17H,5-12,18-22,27H2,1-4H3;1H |
| InChIKey | FAKVEEKAHRADKB-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|