About methyl hydrogen sulfate;methyl 3-phosphanylhexadecanoate
methyl hydrogen sulfate;methyl 3-phosphanylhexadecanoate (PubChem CID 173461064) has the molecular formula C18H39O6PS
and a molecular weight of 414.55 g/mol. Its IUPAC name is methyl hydrogen sulfate;methyl 3-phosphanylhexadecanoate.
Molecular Properties
| Compound Name | methyl hydrogen sulfate;methyl 3-phosphanylhexadecanoate |
| PubChem CID | 173461064 |
| Molecular Formula | C18H39O6PS |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | methyl hydrogen sulfate;methyl 3-phosphanylhexadecanoate |
| SMILES | CCCCCCCCCCCCCC(P)CC(=O)OC.COS(=O)(=O)O |
| InChI | InChI=1S/C17H35O2P.CH4O4S/c1-3-4-5-6-7-8-9-10-11-12-13-14-16(20)15-17(18)19-2;1-5-6(2,3)4/h16H,3-15,20H2,1-2H3;1H3,(H,2,3,4) |
| InChIKey | BVSLCTDCAFOFAM-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze methyl hydrogen sulfate;methyl 3-phosphanylhexadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl hydrogen sulfate;methyl 3-phosphanylhexadecanoate?
The IUPAC name of methyl hydrogen sulfate;methyl 3-phosphanylhexadecanoate (CID 173461064) is methyl hydrogen sulfate;methyl 3-phosphanylhexadecanoate.
What is the SMILES notation for methyl hydrogen sulfate;methyl 3-phosphanylhexadecanoate?
The canonical SMILES for methyl hydrogen sulfate;methyl 3-phosphanylhexadecanoate is CCCCCCCCCCCCCC(P)CC(=O)OC.COS(=O)(=O)O.
What is the InChIKey of methyl hydrogen sulfate;methyl 3-phosphanylhexadecanoate?
The InChIKey is BVSLCTDCAFOFAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H35O2P.CH4O4S/c1-3-4-5-6-7-8-9-10-11-12-13-14-16(20)15-17(18)19-2;1-5-6(2,3)4/h16H,3-15,20H2,1-2H3;1H3,(H,2,3,4).
What are the key properties of methyl hydrogen sulfate;methyl 3-phosphanylhexadecanoate?
methyl hydrogen sulfate;methyl 3-phosphanylhexadecanoate has a molecular weight of 414.55 g/mol, XLogP of 4.93, 15 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl hydrogen sulfate;methyl 3-phosphanylhexadecanoate is sourced from PubChem (CID 173461064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).