C10H12O2 — CID 173461999
4-ethyl-4-methyl-2,3-dioxabicyclo[3.2.2]nona-1(7),5,8-triene (PubChem CID 173461999) has the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. Its IUPAC name is 4-ethyl-4-methyl-2,3-dioxabicyclo[3.2.2]nona-1(7),5,8-triene.
| Compound Name | 4-ethyl-4-methyl-2,3-dioxabicyclo[3.2.2]nona-1(7),5,8-triene |
|---|---|
| PubChem CID | 173461999 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 4-ethyl-4-methyl-2,3-dioxabicyclo[3.2.2]nona-1(7),5,8-triene |
| SMILES | CCC1(C)OOc2ccc1cc2 |
| InChI | InChI=1S/C10H12O2/c1-3-10(2)8-4-6-9(7-5-8)11-12-10/h4-7H,3H2,1-2H3 |
| InChIKey | STPFDKILKGJYDO-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|