About 3-(4-phenyl-1,2-dihydropyridin-6-yl)propan-1-ol
3-(4-phenyl-1,2-dihydropyridin-6-yl)propan-1-ol (PubChem CID 173463409) has the molecular formula C14H17NO
and a molecular weight of 215.30 g/mol. Its IUPAC name is 3-(4-phenyl-1,2-dihydropyridin-6-yl)propan-1-ol.
Molecular Properties
| Compound Name | 3-(4-phenyl-1,2-dihydropyridin-6-yl)propan-1-ol |
| PubChem CID | 173463409 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 3-(4-phenyl-1,2-dihydropyridin-6-yl)propan-1-ol |
| SMILES | OCCCC1=CC(c2ccccc2)=CCN1 |
| InChI | InChI=1S/C14H17NO/c16-10-4-7-14-11-13(8-9-15-14)12-5-2-1-3-6-12/h1-3,5-6,8,11,15-16H,4,7,9-10H2 |
| InChIKey | SMXHJEOOASYLQQ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(4-phenyl-1,2-dihydropyridin-6-yl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-phenyl-1,2-dihydropyridin-6-yl)propan-1-ol?
The IUPAC name of 3-(4-phenyl-1,2-dihydropyridin-6-yl)propan-1-ol (CID 173463409) is 3-(4-phenyl-1,2-dihydropyridin-6-yl)propan-1-ol.
What is the SMILES notation for 3-(4-phenyl-1,2-dihydropyridin-6-yl)propan-1-ol?
The canonical SMILES for 3-(4-phenyl-1,2-dihydropyridin-6-yl)propan-1-ol is OCCCC1=CC(c2ccccc2)=CCN1.
What is the InChIKey of 3-(4-phenyl-1,2-dihydropyridin-6-yl)propan-1-ol?
The InChIKey is SMXHJEOOASYLQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO/c16-10-4-7-14-11-13(8-9-15-14)12-5-2-1-3-6-12/h1-3,5-6,8,11,15-16H,4,7,9-10H2.
What are the key properties of 3-(4-phenyl-1,2-dihydropyridin-6-yl)propan-1-ol?
3-(4-phenyl-1,2-dihydropyridin-6-yl)propan-1-ol has a molecular weight of 215.30 g/mol, XLogP of 2.33, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-phenyl-1,2-dihydropyridin-6-yl)propan-1-ol is sourced from PubChem (CID 173463409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).