About 1-prop-2-enyltriazole-4,5-dicarbaldehyde
1-prop-2-enyltriazole-4,5-dicarbaldehyde (PubChem CID 173463571) has the molecular formula C7H7N3O2
and a molecular weight of 165.15 g/mol. Its IUPAC name is 1-prop-2-enyltriazole-4,5-dicarbaldehyde.
Molecular Properties
| Compound Name | 1-prop-2-enyltriazole-4,5-dicarbaldehyde |
| PubChem CID | 173463571 |
| Molecular Formula | C7H7N3O2 |
| Molecular Weight | 165.15 g/mol |
| Exact Mass | 165.05 |
| IUPAC Name | 1-prop-2-enyltriazole-4,5-dicarbaldehyde |
| SMILES | C=CCn1nnc(C=O)c1C=O |
| InChI | InChI=1S/C7H7N3O2/c1-2-3-10-7(5-12)6(4-11)8-9-10/h2,4-5H,1,3H2 |
| InChIKey | QKTXSGQTMYPJBY-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.15 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-prop-2-enyltriazole-4,5-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-prop-2-enyltriazole-4,5-dicarbaldehyde?
The IUPAC name of 1-prop-2-enyltriazole-4,5-dicarbaldehyde (CID 173463571) is 1-prop-2-enyltriazole-4,5-dicarbaldehyde.
What is the SMILES notation for 1-prop-2-enyltriazole-4,5-dicarbaldehyde?
The canonical SMILES for 1-prop-2-enyltriazole-4,5-dicarbaldehyde is C=CCn1nnc(C=O)c1C=O.
What is the InChIKey of 1-prop-2-enyltriazole-4,5-dicarbaldehyde?
The InChIKey is QKTXSGQTMYPJBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O2/c1-2-3-10-7(5-12)6(4-11)8-9-10/h2,4-5H,1,3H2.
What are the key properties of 1-prop-2-enyltriazole-4,5-dicarbaldehyde?
1-prop-2-enyltriazole-4,5-dicarbaldehyde has a molecular weight of 165.15 g/mol, XLogP of 0.09, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-prop-2-enyltriazole-4,5-dicarbaldehyde is sourced from PubChem (CID 173463571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).