About amino-[3-(2,6-difluorophenyl)-5-(trifluoromethyl)phenyl]-oxoazanium
amino-[3-(2,6-difluorophenyl)-5-(trifluoromethyl)phenyl]-oxoazanium (PubChem CID 173463934) has the molecular formula C13H8F5N2O+
and a molecular weight of 303.21 g/mol. Its IUPAC name is amino-[3-(2,6-difluorophenyl)-5-(trifluoromethyl)phenyl]-oxoazanium.
Molecular Properties
| Compound Name | amino-[3-(2,6-difluorophenyl)-5-(trifluoromethyl)phenyl]-oxoazanium |
| PubChem CID | 173463934 |
| Molecular Formula | C13H8F5N2O+ |
| Molecular Weight | 303.21 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | amino-[3-(2,6-difluorophenyl)-5-(trifluoromethyl)phenyl]-oxoazanium |
| SMILES | N[N+](=O)c1cc(-c2c(F)cccc2F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H8F5N2O/c14-10-2-1-3-11(15)12(10)7-4-8(13(16,17)18)6-9(5-7)20(19)21/h1-6H,(H2,19,21)/q+1 |
| InChIKey | MGAFHVKDCHKRCT-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 46.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.21 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze amino-[3-(2,6-difluorophenyl)-5-(trifluoromethyl)phenyl]-oxoazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of amino-[3-(2,6-difluorophenyl)-5-(trifluoromethyl)phenyl]-oxoazanium?
The IUPAC name of amino-[3-(2,6-difluorophenyl)-5-(trifluoromethyl)phenyl]-oxoazanium (CID 173463934) is amino-[3-(2,6-difluorophenyl)-5-(trifluoromethyl)phenyl]-oxoazanium.
What is the SMILES notation for amino-[3-(2,6-difluorophenyl)-5-(trifluoromethyl)phenyl]-oxoazanium?
The canonical SMILES for amino-[3-(2,6-difluorophenyl)-5-(trifluoromethyl)phenyl]-oxoazanium is N[N+](=O)c1cc(-c2c(F)cccc2F)cc(C(F)(F)F)c1.
What is the InChIKey of amino-[3-(2,6-difluorophenyl)-5-(trifluoromethyl)phenyl]-oxoazanium?
The InChIKey is MGAFHVKDCHKRCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8F5N2O/c14-10-2-1-3-11(15)12(10)7-4-8(13(16,17)18)6-9(5-7)20(19)21/h1-6H,(H2,19,21)/q+1.
What are the key properties of amino-[3-(2,6-difluorophenyl)-5-(trifluoromethyl)phenyl]-oxoazanium?
amino-[3-(2,6-difluorophenyl)-5-(trifluoromethyl)phenyl]-oxoazanium has a molecular weight of 303.21 g/mol, XLogP of 3.93, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for amino-[3-(2,6-difluorophenyl)-5-(trifluoromethyl)phenyl]-oxoazanium is sourced from PubChem (CID 173463934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).