About 1-fluoro-N,N-dimethylcyclohexa-2,4-dien-1-amine
1-fluoro-N,N-dimethylcyclohexa-2,4-dien-1-amine (PubChem CID 173464044) has the molecular formula C8H12FN
and a molecular weight of 141.19 g/mol. Its IUPAC name is 1-fluoro-N,N-dimethylcyclohexa-2,4-dien-1-amine.
Molecular Properties
| Compound Name | 1-fluoro-N,N-dimethylcyclohexa-2,4-dien-1-amine |
| PubChem CID | 173464044 |
| Molecular Formula | C8H12FN |
| Molecular Weight | 141.19 g/mol |
| Exact Mass | 141.10 |
| IUPAC Name | 1-fluoro-N,N-dimethylcyclohexa-2,4-dien-1-amine |
| SMILES | CN(C)C1(F)C=CC=CC1 |
| InChI | InChI=1S/C8H12FN/c1-10(2)8(9)6-4-3-5-7-8/h3-6H,7H2,1-2H3 |
| InChIKey | BLZJIVLKWRQDJM-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.19 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-fluoro-N,N-dimethylcyclohexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-N,N-dimethylcyclohexa-2,4-dien-1-amine?
The IUPAC name of 1-fluoro-N,N-dimethylcyclohexa-2,4-dien-1-amine (CID 173464044) is 1-fluoro-N,N-dimethylcyclohexa-2,4-dien-1-amine.
What is the SMILES notation for 1-fluoro-N,N-dimethylcyclohexa-2,4-dien-1-amine?
The canonical SMILES for 1-fluoro-N,N-dimethylcyclohexa-2,4-dien-1-amine is CN(C)C1(F)C=CC=CC1.
What is the InChIKey of 1-fluoro-N,N-dimethylcyclohexa-2,4-dien-1-amine?
The InChIKey is BLZJIVLKWRQDJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12FN/c1-10(2)8(9)6-4-3-5-7-8/h3-6H,7H2,1-2H3.
What are the key properties of 1-fluoro-N,N-dimethylcyclohexa-2,4-dien-1-amine?
1-fluoro-N,N-dimethylcyclohexa-2,4-dien-1-amine has a molecular weight of 141.19 g/mol, XLogP of 1.73, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-N,N-dimethylcyclohexa-2,4-dien-1-amine is sourced from PubChem (CID 173464044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).