C21H28N2O2 — CID 173464064
N-[(2S,3S)-2-amino-3-methylpentyl]-2-[4-(methoxymethyl)phenyl]benzamide (PubChem CID 173464064) has the molecular formula C21H28N2O2 and a molecular weight of 340.47 g/mol. Its IUPAC name is N-[(2S,3S)-2-amino-3-methylpentyl]-2-[4-(methoxymethyl)phenyl]benzamide.
| Compound Name | N-[(2S,3S)-2-amino-3-methylpentyl]-2-[4-(methoxymethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 173464064 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | N-[(2S,3S)-2-amino-3-methylpentyl]-2-[4-(methoxymethyl)phenyl]benzamide |
| SMILES | CC[C@H](C)[C@H](N)CNC(=O)c1ccccc1-c1ccc(COC)cc1 |
| InChI | InChI=1S/C21H28N2O2/c1-4-15(2)20(22)13-23-21(24)19-8-6-5-7-18(19)17-11-9-16(10-12-17)14-25-3/h5-12,15,20H,4,13-14,22H2,1-3H3,(H,23,24)/t15-,20+/m0/s1 |
| InChIKey | BUMQEAUPVATPQR-MGPUTAFESA-N |
| XLogP | 3.60 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |