C22H27N5O3S — CID 173464946
1-[[(E)-1-[5-(2,3-dihydro-1H-inden-5-yl)-4-hydroxy-1-methylpyrazol-3-yl]ethylideneamino]carbamothioyl]piperidine-4-carboxylic acid (PubChem CID 173464946) has the molecular formula C22H27N5O3S and a molecular weight of 441.56 g/mol. Its IUPAC name is 1-[[(E)-1-[5-(2,3-dihydro-1H-inden-5-yl)-4-hydroxy-1-methylpyrazol-3-yl]ethylideneamino]carbamothioyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[[(E)-1-[5-(2,3-dihydro-1H-inden-5-yl)-4-hydroxy-1-methylpyrazol-3-yl]ethylideneamino]carbamothioyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 173464946 |
| Molecular Formula | C22H27N5O3S |
| Molecular Weight | 441.56 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | 1-[[(E)-1-[5-(2,3-dihydro-1H-inden-5-yl)-4-hydroxy-1-methylpyrazol-3-yl]ethylideneamino]carbamothioyl]piperidine-4-carboxylic acid |
| SMILES | C/C(=N\NC(=S)N1CCC(C(=O)O)CC1)c1nn(C)c(-c2ccc3c(c2)CCC3)c1O |
| InChI | InChI=1S/C22H27N5O3S/c1-13(23-24-22(31)27-10-8-15(9-11-27)21(29)30)18-20(28)19(26(2)25-18)17-7-6-14-4-3-5-16(14)12-17/h6-7,12,15,28H,3-5,8-11H2,1-2H3,(H,24,31)(H,29,30)/b23-13+ |
| InChIKey | BGBZIWKCBZWVEW-YDZHTSKRSA-N |
| XLogP | 2.68 |
| TPSA | 102.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.56 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|