C13H13Br2F7O3S2 — CID 173465174
1,5-dibromo-5-(1-ethylsulfonylethyl)-3-(1,1,2,2,3,3,3-heptafluoropropylsulfinyl)cyclohexa-1,3-diene (PubChem CID 173465174) has the molecular formula C13H13Br2F7O3S2 and a molecular weight of 574.17 g/mol. Its IUPAC name is 1,5-dibromo-5-(1-ethylsulfonylethyl)-3-(1,1,2,2,3,3,3-heptafluoropropylsulfinyl)cyclohexa-1,3-diene.
| Compound Name | 1,5-dibromo-5-(1-ethylsulfonylethyl)-3-(1,1,2,2,3,3,3-heptafluoropropylsulfinyl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 173465174 |
| Molecular Formula | C13H13Br2F7O3S2 |
| Molecular Weight | 574.17 g/mol |
| Exact Mass | 571.86 |
| IUPAC Name | 1,5-dibromo-5-(1-ethylsulfonylethyl)-3-(1,1,2,2,3,3,3-heptafluoropropylsulfinyl)cyclohexa-1,3-diene |
| SMILES | CCS(=O)(=O)C(C)C1(Br)C=C(S(=O)C(F)(F)C(F)(F)C(F)(F)F)C=C(Br)C1 |
| InChI | InChI=1S/C13H13Br2F7O3S2/c1-3-27(24,25)7(2)10(15)5-8(14)4-9(6-10)26(23)13(21,22)11(16,17)12(18,19)20/h4,6-7H,3,5H2,1-2H3 |
| InChIKey | NPNTYHQFTLUXFV-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.17 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|