C19H29F2NO3S — CID 173465523
tert-butyl-[[(1S)-1-(3,5-difluorophenyl)-4-methyl-4-(4-methyl-1,3-dioxetan-2-yl)pentyl]amino]-oxidosulfanium (PubChem CID 173465523) has the molecular formula C19H29F2NO3S and a molecular weight of 389.51 g/mol. Its IUPAC name is tert-butyl-[[(1S)-1-(3,5-difluorophenyl)-4-methyl-4-(4-methyl-1,3-dioxetan-2-yl)pentyl]amino]-oxidosulfanium.
| Compound Name | tert-butyl-[[(1S)-1-(3,5-difluorophenyl)-4-methyl-4-(4-methyl-1,3-dioxetan-2-yl)pentyl]amino]-oxidosulfanium |
|---|---|
| PubChem CID | 173465523 |
| Molecular Formula | C19H29F2NO3S |
| Molecular Weight | 389.51 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | tert-butyl-[[(1S)-1-(3,5-difluorophenyl)-4-methyl-4-(4-methyl-1,3-dioxetan-2-yl)pentyl]amino]-oxidosulfanium |
| SMILES | CC1OC(C(C)(C)CC[C@H](N[S+]([O-])C(C)(C)C)c2cc(F)cc(F)c2)O1 |
| InChI | InChI=1S/C19H29F2NO3S/c1-12-24-17(25-12)19(5,6)8-7-16(22-26(23)18(2,3)4)13-9-14(20)11-15(21)10-13/h9-12,16-17,22H,7-8H2,1-6H3/t12?,16-,17?,26?/m0/s1 |
| InChIKey | MRTLRSKRPJRNKQ-CTQAMBJPSA-N |
| XLogP | 4.58 |
| TPSA | 53.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.51 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|